Просмотр исходного кода

HUE-3638 [metastore] Scroll bar disappearing when scrolling

This introduces a custom version of NiceScroll because the original code is not working nicely
Enrico Berti 10 лет назад
Родитель
Сommit
f4b277f

+ 0 - 120
desktop/core/src/desktop/static/desktop/ext/js/jquery/plugins/jquery.nicescroll.min.js

@@ -1,120 +0,0 @@
-/* jquery.nicescroll 3.6.8 InuYaksa*2015 MIT http://nicescroll.areaaperta.com */(function(f){"function"===typeof define&&define.amd?define(["jquery"],f):"object"===typeof exports?module.exports=f(require("jquery")):f(jQuery)})(function(f){var B=!1,F=!1,O=0,P=2E3,A=0,J=["webkit","ms","moz","o"],v=window.requestAnimationFrame||!1,w=window.cancelAnimationFrame||!1;if(!v)for(var Q in J){var G=J[Q];if(v=window[G+"RequestAnimationFrame"]){w=window[G+"CancelAnimationFrame"]||window[G+"CancelRequestAnimationFrame"];break}}var x=window.MutationObserver||window.WebKitMutationObserver||
-!1,K={zindex:"auto",cursoropacitymin:0,cursoropacitymax:1,cursorcolor:"#424242",cursorwidth:"6px",cursorborder:"1px solid #fff",cursorborderradius:"5px",scrollspeed:60,mousescrollstep:24,touchbehavior:!1,hwacceleration:!0,usetransition:!0,boxzoom:!1,dblclickzoom:!0,gesturezoom:!0,grabcursorenabled:!0,autohidemode:!0,background:"",iframeautoresize:!0,cursorminheight:32,preservenativescrolling:!0,railoffset:!1,railhoffset:!1,bouncescroll:!0,spacebarenabled:!0,railpadding:{top:0,right:0,left:0,bottom:0},
-disableoutline:!0,horizrailenabled:!0,railalign:"right",railvalign:"bottom",enabletranslate3d:!0,enablemousewheel:!0,enablekeyboard:!0,smoothscroll:!0,sensitiverail:!0,enablemouselockapi:!0,cursorfixedheight:!1,directionlockdeadzone:6,hidecursordelay:400,nativeparentscrolling:!0,enablescrollonselection:!0,overflowx:!0,overflowy:!0,cursordragspeed:.3,rtlmode:"auto",cursordragontouch:!1,oneaxismousemode:"auto",scriptpath:function(){var f=document.getElementsByTagName("script"),f=f.length?f[f.length-
-1].src.split("?")[0]:"";return 0<f.split("/").length?f.split("/").slice(0,-1).join("/")+"/":""}(),preventmultitouchscrolling:!0,disablemutationobserver:!1},H=!1,R=function(){if(H)return H;var f=document.createElement("DIV"),c=f.style,k=navigator.userAgent,l=navigator.platform,d={haspointerlock:"pointerLockElement"in document||"webkitPointerLockElement"in document||"mozPointerLockElement"in document};d.isopera="opera"in window;d.isopera12=d.isopera&&"getUserMedia"in navigator;d.isoperamini="[object OperaMini]"===
-Object.prototype.toString.call(window.operamini);d.isie="all"in document&&"attachEvent"in f&&!d.isopera;d.isieold=d.isie&&!("msInterpolationMode"in c);d.isie7=d.isie&&!d.isieold&&(!("documentMode"in document)||7==document.documentMode);d.isie8=d.isie&&"documentMode"in document&&8==document.documentMode;d.isie9=d.isie&&"performance"in window&&9==document.documentMode;d.isie10=d.isie&&"performance"in window&&10==document.documentMode;d.isie11="msRequestFullscreen"in f&&11<=document.documentMode;d.isieedge12=
-navigator.userAgent.match(/Edge\/12\./);d.isieedge="msOverflowStyle"in f;d.ismodernie=d.isie11||d.isieedge;d.isie9mobile=/iemobile.9/i.test(k);d.isie9mobile&&(d.isie9=!1);d.isie7mobile=!d.isie9mobile&&d.isie7&&/iemobile/i.test(k);d.ismozilla="MozAppearance"in c;d.iswebkit="WebkitAppearance"in c;d.ischrome="chrome"in window;d.ischrome38=d.ischrome&&"touchAction"in c;d.ischrome22=!d.ischrome38&&d.ischrome&&d.haspointerlock;d.ischrome26=!d.ischrome38&&d.ischrome&&"transition"in c;d.cantouch="ontouchstart"in
-document.documentElement||"ontouchstart"in window;d.hasw3ctouch=(window.PointerEvent||!1)&&(0<navigator.MaxTouchPoints||0<navigator.msMaxTouchPoints);d.hasmstouch=!d.hasw3ctouch&&(window.MSPointerEvent||!1);d.ismac=/^mac$/i.test(l);d.isios=d.cantouch&&/iphone|ipad|ipod/i.test(l);d.isios4=d.isios&&!("seal"in Object);d.isios7=d.isios&&"webkitHidden"in document;d.isios8=d.isios&&"hidden"in document;d.isandroid=/android/i.test(k);d.haseventlistener="addEventListener"in f;d.trstyle=!1;d.hastransform=!1;
-d.hastranslate3d=!1;d.transitionstyle=!1;d.hastransition=!1;d.transitionend=!1;l=["transform","msTransform","webkitTransform","MozTransform","OTransform"];for(k=0;k<l.length;k++)if(void 0!==c[l[k]]){d.trstyle=l[k];break}d.hastransform=!!d.trstyle;d.hastransform&&(c[d.trstyle]="translate3d(1px,2px,3px)",d.hastranslate3d=/translate3d/.test(c[d.trstyle]));d.transitionstyle=!1;d.prefixstyle="";d.transitionend=!1;for(var l="transition webkitTransition msTransition MozTransition OTransition OTransition KhtmlTransition".split(" "),
-q=" -webkit- -ms- -moz- -o- -o -khtml-".split(" "),t="transitionend webkitTransitionEnd msTransitionEnd transitionend otransitionend oTransitionEnd KhtmlTransitionEnd".split(" "),k=0;k<l.length;k++)if(l[k]in c){d.transitionstyle=l[k];d.prefixstyle=q[k];d.transitionend=t[k];break}d.ischrome26&&(d.prefixstyle=q[1]);d.hastransition=d.transitionstyle;a:{k=["grab","-webkit-grab","-moz-grab"];if(d.ischrome&&!d.ischrome38||d.isie)k=[];for(l=0;l<k.length;l++)if(q=k[l],c.cursor=q,c.cursor==q){c=q;break a}c=
-"url(//patriciaportfolio.googlecode.com/files/openhand.cur),n-resize"}d.cursorgrabvalue=c;d.hasmousecapture="setCapture"in f;d.hasMutationObserver=!1!==x;return H=d},S=function(h,c){function k(){var b=a.doc.css(e.trstyle);return b&&"matrix"==b.substr(0,6)?b.replace(/^.*\((.*)\)$/g,"$1").replace(/px/g,"").split(/, +/):!1}function l(){var b=a.win;if("zIndex"in b)return b.zIndex();for(;0<b.length&&9!=b[0].nodeType;){var g=b.css("zIndex");if(!isNaN(g)&&0!=g)return parseInt(g);b=b.parent()}return!1}function d(b,
-g,u){g=b.css(g);b=parseFloat(g);return isNaN(b)?(b=z[g]||0,u=3==b?u?a.win.outerHeight()-a.win.innerHeight():a.win.outerWidth()-a.win.innerWidth():1,a.isie8&&b&&(b+=1),u?b:0):b}function q(b,g,u,c){a._bind(b,g,function(a){a=a?a:window.event;var c={original:a,target:a.target||a.srcElement,type:"wheel",deltaMode:"MozMousePixelScroll"==a.type?0:1,deltaX:0,deltaZ:0,preventDefault:function(){a.preventDefault?a.preventDefault():a.returnValue=!1;return!1},stopImmediatePropagation:function(){a.stopImmediatePropagation?
-a.stopImmediatePropagation():a.cancelBubble=!0}};"mousewheel"==g?(a.wheelDeltaX&&(c.deltaX=-.025*a.wheelDeltaX),a.wheelDeltaY&&(c.deltaY=-.025*a.wheelDeltaY),c.deltaY||c.deltaX||(c.deltaY=-.025*a.wheelDelta)):c.deltaY=a.detail;return u.call(b,c)},c)}function t(b,g,c){var d,e;0==b.deltaMode?(d=-Math.floor(a.opt.mousescrollstep/54*b.deltaX),e=-Math.floor(a.opt.mousescrollstep/54*b.deltaY)):1==b.deltaMode&&(d=-Math.floor(b.deltaX*a.opt.mousescrollstep),e=-Math.floor(b.deltaY*a.opt.mousescrollstep));
-g&&a.opt.oneaxismousemode&&0==d&&e&&(d=e,e=0,c&&(0>d?a.getScrollLeft()>=a.page.maxw:0>=a.getScrollLeft())&&(e=d,d=0));a.isrtlmode&&(d=-d);d&&(a.scrollmom&&a.scrollmom.stop(),a.lastdeltax+=d,a.debounced("mousewheelx",function(){var b=a.lastdeltax;a.lastdeltax=0;a.rail.drag||a.doScrollLeftBy(b)},15));if(e){if(a.opt.nativeparentscrolling&&c&&!a.ispage&&!a.zoomactive)if(0>e){if(a.getScrollTop()>=a.page.maxh)return!0}else if(0>=a.getScrollTop())return!0;a.scrollmom&&a.scrollmom.stop();a.lastdeltay+=e;
-a.synched("mousewheely",function(){var b=a.lastdeltay;a.lastdeltay=0;a.rail.drag||a.doScrollBy(b)},15)}b.stopImmediatePropagation();return b.preventDefault()}var a=this;this.version="3.6.8";this.name="nicescroll";this.me=c;this.opt={doc:f("body"),win:!1};f.extend(this.opt,K);this.opt.snapbackspeed=80;if(h)for(var r in a.opt)void 0!==h[r]&&(a.opt[r]=h[r]);a.opt.disablemutationobserver&&(x=!1);this.iddoc=(this.doc=a.opt.doc)&&this.doc[0]?this.doc[0].id||"":"";this.ispage=/^BODY|HTML/.test(a.opt.win?
-a.opt.win[0].nodeName:this.doc[0].nodeName);this.haswrapper=!1!==a.opt.win;this.win=a.opt.win||(this.ispage?f(window):this.doc);this.docscroll=this.ispage&&!this.haswrapper?f(window):this.win;this.body=f("body");this.iframe=this.isfixed=this.viewport=!1;this.isiframe="IFRAME"==this.doc[0].nodeName&&"IFRAME"==this.win[0].nodeName;this.istextarea="TEXTAREA"==this.win[0].nodeName;this.forcescreen=!1;this.canshowonmouseevent="scroll"!=a.opt.autohidemode;this.page=this.view=this.onzoomout=this.onzoomin=
-this.onscrollcancel=this.onscrollend=this.onscrollstart=this.onclick=this.ongesturezoom=this.onkeypress=this.onmousewheel=this.onmousemove=this.onmouseup=this.onmousedown=!1;this.scroll={x:0,y:0};this.scrollratio={x:0,y:0};this.cursorheight=20;this.scrollvaluemax=0;if("auto"==this.opt.rtlmode){r=this.win[0]==window?this.body:this.win;var p=r.css("writing-mode")||r.css("-webkit-writing-mode")||r.css("-ms-writing-mode")||r.css("-moz-writing-mode");"horizontal-tb"==p||"lr-tb"==p||""==p?(this.isrtlmode=
-"rtl"==r.css("direction"),this.isvertical=!1):(this.isrtlmode="vertical-rl"==p||"tb"==p||"tb-rl"==p||"rl-tb"==p,this.isvertical="vertical-rl"==p||"tb"==p||"tb-rl"==p)}else this.isrtlmode=!0===this.opt.rtlmode,this.isvertical=!1;this.observerbody=this.observerremover=this.observer=this.scrollmom=this.scrollrunning=!1;do this.id="ascrail"+P++;while(document.getElementById(this.id));this.hasmousefocus=this.hasfocus=this.zoomactive=this.zoom=this.selectiondrag=this.cursorfreezed=this.cursor=this.rail=
-!1;this.visibility=!0;this.hidden=this.locked=this.railslocked=!1;this.cursoractive=!0;this.wheelprevented=!1;this.overflowx=a.opt.overflowx;this.overflowy=a.opt.overflowy;this.nativescrollingarea=!1;this.checkarea=0;this.events=[];this.saved={};this.delaylist={};this.synclist={};this.lastdeltay=this.lastdeltax=0;this.detected=R();var e=f.extend({},this.detected);this.ishwscroll=(this.canhwscroll=e.hastransform&&a.opt.hwacceleration)&&a.haswrapper;this.hasreversehr=this.isrtlmode?this.isvertical?
-!(e.iswebkit||e.isie||e.isie11):!(e.iswebkit||e.isie&&!e.isie10&&!e.isie11):!1;this.istouchcapable=!1;e.cantouch||!e.hasw3ctouch&&!e.hasmstouch?!e.cantouch||e.isios||e.isandroid||!e.iswebkit&&!e.ismozilla||(this.istouchcapable=!0):this.istouchcapable=!0;a.opt.enablemouselockapi||(e.hasmousecapture=!1,e.haspointerlock=!1);this.debounced=function(b,g,c){a&&(a.delaylist[b]||(g.call(a),a.delaylist[b]={h:v(function(){a.delaylist[b].fn.call(a);a.delaylist[b]=!1},c)}),a.delaylist[b].fn=g)};var I=!1;this.synched=
-function(b,g){a.synclist[b]=g;(function(){I||(v(function(){if(a){I=!1;for(var b in a.synclist){var g=a.synclist[b];g&&g.call(a);a.synclist[b]=!1}}}),I=!0)})();return b};this.unsynched=function(b){a.synclist[b]&&(a.synclist[b]=!1)};this.css=function(b,g){for(var c in g)a.saved.css.push([b,c,b.css(c)]),b.css(c,g[c])};this.scrollTop=function(b){return void 0===b?a.getScrollTop():a.setScrollTop(b)};this.scrollLeft=function(b){return void 0===b?a.getScrollLeft():a.setScrollLeft(b)};var D=function(a,g,
-c,d,e,f,k){this.st=a;this.ed=g;this.spd=c;this.p1=d||0;this.p2=e||1;this.p3=f||0;this.p4=k||1;this.ts=(new Date).getTime();this.df=this.ed-this.st};D.prototype={B2:function(a){return 3*a*a*(1-a)},B3:function(a){return 3*a*(1-a)*(1-a)},B4:function(a){return(1-a)*(1-a)*(1-a)},getNow:function(){var a=1-((new Date).getTime()-this.ts)/this.spd,g=this.B2(a)+this.B3(a)+this.B4(a);return 0>a?this.ed:this.st+Math.round(this.df*g)},update:function(a,g){this.st=this.getNow();this.ed=a;this.spd=g;this.ts=(new Date).getTime();
-this.df=this.ed-this.st;return this}};if(this.ishwscroll){this.doc.translate={x:0,y:0,tx:"0px",ty:"0px"};e.hastranslate3d&&e.isios&&this.doc.css("-webkit-backface-visibility","hidden");this.getScrollTop=function(b){if(!b){if(b=k())return 16==b.length?-b[13]:-b[5];if(a.timerscroll&&a.timerscroll.bz)return a.timerscroll.bz.getNow()}return a.doc.translate.y};this.getScrollLeft=function(b){if(!b){if(b=k())return 16==b.length?-b[12]:-b[4];if(a.timerscroll&&a.timerscroll.bh)return a.timerscroll.bh.getNow()}return a.doc.translate.x};
-this.notifyScrollEvent=function(a){var g=document.createEvent("UIEvents");g.initUIEvent("scroll",!1,!0,window,1);g.niceevent=!0;a.dispatchEvent(g)};var y=this.isrtlmode?1:-1;e.hastranslate3d&&a.opt.enabletranslate3d?(this.setScrollTop=function(b,g){a.doc.translate.y=b;a.doc.translate.ty=-1*b+"px";a.doc.css(e.trstyle,"translate3d("+a.doc.translate.tx+","+a.doc.translate.ty+",0px)");g||a.notifyScrollEvent(a.win[0])},this.setScrollLeft=function(b,g){a.doc.translate.x=b;a.doc.translate.tx=b*y+"px";a.doc.css(e.trstyle,
-"translate3d("+a.doc.translate.tx+","+a.doc.translate.ty+",0px)");g||a.notifyScrollEvent(a.win[0])}):(this.setScrollTop=function(b,g){a.doc.translate.y=b;a.doc.translate.ty=-1*b+"px";a.doc.css(e.trstyle,"translate("+a.doc.translate.tx+","+a.doc.translate.ty+")");g||a.notifyScrollEvent(a.win[0])},this.setScrollLeft=function(b,g){a.doc.translate.x=b;a.doc.translate.tx=b*y+"px";a.doc.css(e.trstyle,"translate("+a.doc.translate.tx+","+a.doc.translate.ty+")");g||a.notifyScrollEvent(a.win[0])})}else this.getScrollTop=
-function(){return a.docscroll.scrollTop()},this.setScrollTop=function(b){return setTimeout(function(){a&&a.docscroll.scrollTop(b)},1)},this.getScrollLeft=function(){return a.hasreversehr?a.detected.ismozilla?a.page.maxw-Math.abs(a.docscroll.scrollLeft()):a.page.maxw-a.docscroll.scrollLeft():a.docscroll.scrollLeft()},this.setScrollLeft=function(b){return setTimeout(function(){if(a)return a.hasreversehr&&(b=a.detected.ismozilla?-(a.page.maxw-b):a.page.maxw-b),a.docscroll.scrollLeft(b)},1)};this.getTarget=
-function(a){return a?a.target?a.target:a.srcElement?a.srcElement:!1:!1};this.hasParent=function(a,g){if(!a)return!1;for(var c=a.target||a.srcElement||a||!1;c&&c.id!=g;)c=c.parentNode||!1;return!1!==c};var z={thin:1,medium:3,thick:5};this.getDocumentScrollOffset=function(){return{top:window.pageYOffset||document.documentElement.scrollTop,left:window.pageXOffset||document.documentElement.scrollLeft}};this.getOffset=function(){if(a.isfixed){var b=a.win.offset(),g=a.getDocumentScrollOffset();b.top-=g.top;
-b.left-=g.left;return b}b=a.win.offset();if(!a.viewport)return b;g=a.viewport.offset();return{top:b.top-g.top,left:b.left-g.left}};this.updateScrollBar=function(b){var g,c,e;if(a.ishwscroll)a.rail.css({height:a.win.innerHeight()-(a.opt.railpadding.top+a.opt.railpadding.bottom)}),a.railh&&a.railh.css({width:a.win.innerWidth()-(a.opt.railpadding.left+a.opt.railpadding.right)});else{var f=a.getOffset();g=f.top;c=f.left-(a.opt.railpadding.left+a.opt.railpadding.right);g+=d(a.win,"border-top-width",!0);
-c+=a.rail.align?a.win.outerWidth()-d(a.win,"border-right-width")-a.rail.width:d(a.win,"border-left-width");if(e=a.opt.railoffset)e.top&&(g+=e.top),e.left&&(c+=e.left);a.railslocked||a.rail.css({top:g,left:c,height:(b?b.h:a.win.innerHeight())-(a.opt.railpadding.top+a.opt.railpadding.bottom)});a.zoom&&a.zoom.css({top:g+1,left:1==a.rail.align?c-20:c+a.rail.width+4});if(a.railh&&!a.railslocked){g=f.top;c=f.left;if(e=a.opt.railhoffset)e.top&&(g+=e.top),e.left&&(c+=e.left);b=a.railh.align?g+d(a.win,"border-top-width",
-!0)+a.win.innerHeight()-a.railh.height:g+d(a.win,"border-top-width",!0);c+=d(a.win,"border-left-width");a.railh.css({top:b-(a.opt.railpadding.top+a.opt.railpadding.bottom),left:c,width:a.railh.width})}}};this.doRailClick=function(b,g,c){var d;a.railslocked||(a.cancelEvent(b),g?(g=c?a.doScrollLeft:a.doScrollTop,d=c?(b.pageX-a.railh.offset().left-a.cursorwidth/2)*a.scrollratio.x:(b.pageY-a.rail.offset().top-a.cursorheight/2)*a.scrollratio.y,g(d)):(g=c?a.doScrollLeftBy:a.doScrollBy,d=c?a.scroll.x:a.scroll.y,
-b=c?b.pageX-a.railh.offset().left:b.pageY-a.rail.offset().top,c=c?a.view.w:a.view.h,g(d>=b?c:-c)))};a.hasanimationframe=v;a.hascancelanimationframe=w;a.hasanimationframe?a.hascancelanimationframe||(w=function(){a.cancelAnimationFrame=!0}):(v=function(a){return setTimeout(a,15-Math.floor(+new Date/1E3)%16)},w=clearTimeout);this.init=function(){a.saved.css=[];if(e.isie7mobile||e.isoperamini)return!0;e.hasmstouch&&a.css(a.ispage?f("html"):a.win,{_touchaction:"none"});var b=e.ismodernie||e.isie10?{"-ms-overflow-style":"none"}:
-{"overflow-y":"hidden"};a.zindex="auto";a.zindex=a.ispage||"auto"!=a.opt.zindex?a.opt.zindex:l()||"auto";!a.ispage&&"auto"!=a.zindex&&a.zindex>A&&(A=a.zindex);a.isie&&0==a.zindex&&"auto"==a.opt.zindex&&(a.zindex="auto");if(!a.ispage||!e.cantouch&&!e.isieold&&!e.isie9mobile){var c=a.docscroll;a.ispage&&(c=a.haswrapper?a.win:a.doc);e.isie9mobile||a.css(c,b);a.ispage&&e.isie7&&("BODY"==a.doc[0].nodeName?a.css(f("html"),{"overflow-y":"hidden"}):"HTML"==a.doc[0].nodeName&&a.css(f("body"),b));!e.isios||
-a.ispage||a.haswrapper||a.css(f("body"),{"-webkit-overflow-scrolling":"touch"});var d=f(document.createElement("div"));d.css({position:"relative",top:0,"float":"right",width:a.opt.cursorwidth,height:0,"background-color":a.opt.cursorcolor,border:a.opt.cursorborder,"background-clip":"padding-box","-webkit-border-radius":a.opt.cursorborderradius,"-moz-border-radius":a.opt.cursorborderradius,"border-radius":a.opt.cursorborderradius});d.hborder=parseFloat(d.outerHeight()-d.innerHeight());d.addClass("nicescroll-cursors");
-a.cursor=d;var m=f(document.createElement("div"));m.attr("id",a.id);m.addClass("nicescroll-rails nicescroll-rails-vr");var k,h,p=["left","right","top","bottom"],L;for(L in p)h=p[L],(k=a.opt.railpadding[h])?m.css("padding-"+h,k+"px"):a.opt.railpadding[h]=0;m.append(d);m.width=Math.max(parseFloat(a.opt.cursorwidth),d.outerWidth());m.css({width:m.width+"px",zIndex:a.zindex,background:a.opt.background,cursor:"default"});m.visibility=!0;m.scrollable=!0;m.align="left"==a.opt.railalign?0:1;a.rail=m;d=a.rail.drag=
-!1;!a.opt.boxzoom||a.ispage||e.isieold||(d=document.createElement("div"),a.bind(d,"click",a.doZoom),a.bind(d,"mouseenter",function(){a.zoom.css("opacity",a.opt.cursoropacitymax)}),a.bind(d,"mouseleave",function(){a.zoom.css("opacity",a.opt.cursoropacitymin)}),a.zoom=f(d),a.zoom.css({cursor:"pointer",zIndex:a.zindex,backgroundImage:"url("+a.opt.scriptpath+"zoomico.png)",height:18,width:18,backgroundPosition:"0px 0px"}),a.opt.dblclickzoom&&a.bind(a.win,"dblclick",a.doZoom),e.cantouch&&a.opt.gesturezoom&&
-(a.ongesturezoom=function(b){1.5<b.scale&&a.doZoomIn(b);.8>b.scale&&a.doZoomOut(b);return a.cancelEvent(b)},a.bind(a.win,"gestureend",a.ongesturezoom)));a.railh=!1;var n;a.opt.horizrailenabled&&(a.css(c,{overflowX:"hidden"}),d=f(document.createElement("div")),d.css({position:"absolute",top:0,height:a.opt.cursorwidth,width:0,backgroundColor:a.opt.cursorcolor,border:a.opt.cursorborder,backgroundClip:"padding-box","-webkit-border-radius":a.opt.cursorborderradius,"-moz-border-radius":a.opt.cursorborderradius,
-"border-radius":a.opt.cursorborderradius}),e.isieold&&d.css("overflow","hidden"),d.wborder=parseFloat(d.outerWidth()-d.innerWidth()),d.addClass("nicescroll-cursors"),a.cursorh=d,n=f(document.createElement("div")),n.attr("id",a.id+"-hr"),n.addClass("nicescroll-rails nicescroll-rails-hr"),n.height=Math.max(parseFloat(a.opt.cursorwidth),d.outerHeight()),n.css({height:n.height+"px",zIndex:a.zindex,background:a.opt.background}),n.append(d),n.visibility=!0,n.scrollable=!0,n.align="top"==a.opt.railvalign?
-0:1,a.railh=n,a.railh.drag=!1);a.ispage?(m.css({position:"fixed",top:0,height:"100%"}),m.align?m.css({right:0}):m.css({left:0}),a.body.append(m),a.railh&&(n.css({position:"fixed",left:0,width:"100%"}),n.align?n.css({bottom:0}):n.css({top:0}),a.body.append(n))):(a.ishwscroll?("static"==a.win.css("position")&&a.css(a.win,{position:"relative"}),c="HTML"==a.win[0].nodeName?a.body:a.win,f(c).scrollTop(0).scrollLeft(0),a.zoom&&(a.zoom.css({position:"absolute",top:1,right:0,"margin-right":m.width+4}),c.append(a.zoom)),
-m.css({position:"absolute",top:0}),m.align?m.css({right:0}):m.css({left:0}),c.append(m),n&&(n.css({position:"absolute",left:0,bottom:0}),n.align?n.css({bottom:0}):n.css({top:0}),c.append(n))):(a.isfixed="fixed"==a.win.css("position"),c=a.isfixed?"fixed":"absolute",a.isfixed||(a.viewport=a.getViewport(a.win[0])),a.viewport&&(a.body=a.viewport,0==/fixed|absolute/.test(a.viewport.css("position"))&&a.css(a.viewport,{position:"relative"})),m.css({position:c}),a.zoom&&a.zoom.css({position:c}),a.updateScrollBar(),
-a.body.append(m),a.zoom&&a.body.append(a.zoom),a.railh&&(n.css({position:c}),a.body.append(n))),e.isios&&a.css(a.win,{"-webkit-tap-highlight-color":"rgba(0,0,0,0)","-webkit-touch-callout":"none"}),e.isie&&a.opt.disableoutline&&a.win.attr("hideFocus","true"),e.iswebkit&&a.opt.disableoutline&&a.win.css("outline","none"));!1===a.opt.autohidemode?(a.autohidedom=!1,a.rail.css({opacity:a.opt.cursoropacitymax}),a.railh&&a.railh.css({opacity:a.opt.cursoropacitymax})):!0===a.opt.autohidemode||"leave"===a.opt.autohidemode?
-(a.autohidedom=f().add(a.rail),e.isie8&&(a.autohidedom=a.autohidedom.add(a.cursor)),a.railh&&(a.autohidedom=a.autohidedom.add(a.railh)),a.railh&&e.isie8&&(a.autohidedom=a.autohidedom.add(a.cursorh))):"scroll"==a.opt.autohidemode?(a.autohidedom=f().add(a.rail),a.railh&&(a.autohidedom=a.autohidedom.add(a.railh))):"cursor"==a.opt.autohidemode?(a.autohidedom=f().add(a.cursor),a.railh&&(a.autohidedom=a.autohidedom.add(a.cursorh))):"hidden"==a.opt.autohidemode&&(a.autohidedom=!1,a.hide(),a.railslocked=
-!1);if(e.isie9mobile)a.scrollmom=new M(a),a.onmangotouch=function(){var b=a.getScrollTop(),c=a.getScrollLeft();if(b==a.scrollmom.lastscrolly&&c==a.scrollmom.lastscrollx)return!0;var g=b-a.mangotouch.sy,d=c-a.mangotouch.sx;if(0!=Math.round(Math.sqrt(Math.pow(d,2)+Math.pow(g,2)))){var e=0>g?-1:1,f=0>d?-1:1,u=+new Date;a.mangotouch.lazy&&clearTimeout(a.mangotouch.lazy);80<u-a.mangotouch.tm||a.mangotouch.dry!=e||a.mangotouch.drx!=f?(a.scrollmom.stop(),a.scrollmom.reset(c,b),a.mangotouch.sy=b,a.mangotouch.ly=
-b,a.mangotouch.sx=c,a.mangotouch.lx=c,a.mangotouch.dry=e,a.mangotouch.drx=f,a.mangotouch.tm=u):(a.scrollmom.stop(),a.scrollmom.update(a.mangotouch.sx-d,a.mangotouch.sy-g),a.mangotouch.tm=u,g=Math.max(Math.abs(a.mangotouch.ly-b),Math.abs(a.mangotouch.lx-c)),a.mangotouch.ly=b,a.mangotouch.lx=c,2<g&&(a.mangotouch.lazy=setTimeout(function(){a.mangotouch.lazy=!1;a.mangotouch.dry=0;a.mangotouch.drx=0;a.mangotouch.tm=0;a.scrollmom.doMomentum(30)},100)))}},m=a.getScrollTop(),n=a.getScrollLeft(),a.mangotouch=
-{sy:m,ly:m,dry:0,sx:n,lx:n,drx:0,lazy:!1,tm:0},a.bind(a.docscroll,"scroll",a.onmangotouch);else{if(e.cantouch||a.istouchcapable||a.opt.touchbehavior||e.hasmstouch){a.scrollmom=new M(a);a.ontouchstart=function(b){if(b.pointerType&&2!=b.pointerType&&"touch"!=b.pointerType)return!1;a.hasmoving=!1;if(!a.railslocked){var c;if(e.hasmstouch)for(c=b.target?b.target:!1;c;){var g=f(c).getNiceScroll();if(0<g.length&&g[0].me==a.me)break;if(0<g.length)return!1;if("DIV"==c.nodeName&&c.id==a.id)break;c=c.parentNode?
-c.parentNode:!1}a.cancelScroll();if((c=a.getTarget(b))&&/INPUT/i.test(c.nodeName)&&/range/i.test(c.type))return a.stopPropagation(b);!("clientX"in b)&&"changedTouches"in b&&(b.clientX=b.changedTouches[0].clientX,b.clientY=b.changedTouches[0].clientY);a.forcescreen&&(g=b,b={original:b.original?b.original:b},b.clientX=g.screenX,b.clientY=g.screenY);a.rail.drag={x:b.clientX,y:b.clientY,sx:a.scroll.x,sy:a.scroll.y,st:a.getScrollTop(),sl:a.getScrollLeft(),pt:2,dl:!1};if(a.ispage||!a.opt.directionlockdeadzone)a.rail.drag.dl=
-"f";else{var g=f(window).width(),d=f(window).height(),d=Math.max(0,Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)-d),g=Math.max(0,Math.max(document.body.scrollWidth,document.documentElement.scrollWidth)-g);a.rail.drag.ck=!a.rail.scrollable&&a.railh.scrollable?0<d?"v":!1:a.rail.scrollable&&!a.railh.scrollable?0<g?"h":!1:!1;a.rail.drag.ck||(a.rail.drag.dl="f")}a.opt.touchbehavior&&a.isiframe&&e.isie&&(g=a.win.position(),a.rail.drag.x+=g.left,a.rail.drag.y+=g.top);a.hasmoving=
-!1;a.lastmouseup=!1;a.scrollmom.reset(b.clientX,b.clientY);if(!e.cantouch&&!this.istouchcapable&&!b.pointerType){if(!c||!/INPUT|SELECT|TEXTAREA/i.test(c.nodeName))return!a.ispage&&e.hasmousecapture&&c.setCapture(),a.opt.touchbehavior?(c.onclick&&!c._onclick&&(c._onclick=c.onclick,c.onclick=function(b){if(a.hasmoving)return!1;c._onclick.call(this,b)}),a.cancelEvent(b)):a.stopPropagation(b);/SUBMIT|CANCEL|BUTTON/i.test(f(c).attr("type"))&&(pc={tg:c,click:!1},a.preventclick=pc)}}};a.ontouchend=function(b){if(!a.rail.drag)return!0;
-if(2==a.rail.drag.pt){if(b.pointerType&&2!=b.pointerType&&"touch"!=b.pointerType)return!1;a.scrollmom.doMomentum();a.rail.drag=!1;if(a.hasmoving&&(a.lastmouseup=!0,a.hideCursor(),e.hasmousecapture&&document.releaseCapture(),!e.cantouch))return a.cancelEvent(b)}else if(1==a.rail.drag.pt)return a.onmouseup(b)};var q=a.opt.touchbehavior&&a.isiframe&&!e.hasmousecapture;a.ontouchmove=function(b,c){if(!a.rail.drag||b.targetTouches&&a.opt.preventmultitouchscrolling&&1<b.targetTouches.length||b.pointerType&&
-2!=b.pointerType&&"touch"!=b.pointerType)return!1;if(2==a.rail.drag.pt){if(e.cantouch&&e.isios&&void 0===b.original)return!0;a.hasmoving=!0;a.preventclick&&!a.preventclick.click&&(a.preventclick.click=a.preventclick.tg.onclick||!1,a.preventclick.tg.onclick=a.onpreventclick);b=f.extend({original:b},b);"changedTouches"in b&&(b.clientX=b.changedTouches[0].clientX,b.clientY=b.changedTouches[0].clientY);if(a.forcescreen){var g=b;b={original:b.original?b.original:b};b.clientX=g.screenX;b.clientY=g.screenY}var d,
-g=d=0;q&&!c&&(d=a.win.position(),g=-d.left,d=-d.top);var u=b.clientY+d;d=u-a.rail.drag.y;var m=b.clientX+g,k=m-a.rail.drag.x,h=a.rail.drag.st-d;a.ishwscroll&&a.opt.bouncescroll?0>h?h=Math.round(h/2):h>a.page.maxh&&(h=a.page.maxh+Math.round((h-a.page.maxh)/2)):(0>h&&(u=h=0),h>a.page.maxh&&(h=a.page.maxh,u=0));var l;a.railh&&a.railh.scrollable&&(l=a.isrtlmode?k-a.rail.drag.sl:a.rail.drag.sl-k,a.ishwscroll&&a.opt.bouncescroll?0>l?l=Math.round(l/2):l>a.page.maxw&&(l=a.page.maxw+Math.round((l-a.page.maxw)/
-2)):(0>l&&(m=l=0),l>a.page.maxw&&(l=a.page.maxw,m=0)));g=!1;if(a.rail.drag.dl)g=!0,"v"==a.rail.drag.dl?l=a.rail.drag.sl:"h"==a.rail.drag.dl&&(h=a.rail.drag.st);else{d=Math.abs(d);var k=Math.abs(k),C=a.opt.directionlockdeadzone;if("v"==a.rail.drag.ck){if(d>C&&k<=.3*d)return a.rail.drag=!1,!0;k>C&&(a.rail.drag.dl="f",f("body").scrollTop(f("body").scrollTop()))}else if("h"==a.rail.drag.ck){if(k>C&&d<=.3*k)return a.rail.drag=!1,!0;d>C&&(a.rail.drag.dl="f",f("body").scrollLeft(f("body").scrollLeft()))}}a.synched("touchmove",
-function(){a.rail.drag&&2==a.rail.drag.pt&&(a.prepareTransition&&a.prepareTransition(0),a.rail.scrollable&&a.setScrollTop(h),a.scrollmom.update(m,u),a.railh&&a.railh.scrollable?(a.setScrollLeft(l),a.showCursor(h,l)):a.showCursor(h),e.isie10&&document.selection.clear())});e.ischrome&&a.istouchcapable&&(g=!1);if(g)return a.cancelEvent(b)}else if(1==a.rail.drag.pt)return a.onmousemove(b)}}a.onmousedown=function(b,c){if(!a.rail.drag||1==a.rail.drag.pt){if(a.railslocked)return a.cancelEvent(b);a.cancelScroll();
-a.rail.drag={x:b.clientX,y:b.clientY,sx:a.scroll.x,sy:a.scroll.y,pt:1,hr:!!c};var g=a.getTarget(b);!a.ispage&&e.hasmousecapture&&g.setCapture();a.isiframe&&!e.hasmousecapture&&(a.saved.csspointerevents=a.doc.css("pointer-events"),a.css(a.doc,{"pointer-events":"none"}));a.hasmoving=!1;return a.cancelEvent(b)}};a.onmouseup=function(b){if(a.rail.drag){if(1!=a.rail.drag.pt)return!0;e.hasmousecapture&&document.releaseCapture();a.isiframe&&!e.hasmousecapture&&a.doc.css("pointer-events",a.saved.csspointerevents);
-a.rail.drag=!1;a.hasmoving&&a.triggerScrollEnd();return a.cancelEvent(b)}};a.onmousemove=function(b){if(a.rail.drag){if(1==a.rail.drag.pt){if(e.ischrome&&0==b.which)return a.onmouseup(b);a.cursorfreezed=!0;a.hasmoving=!0;if(a.rail.drag.hr){a.scroll.x=a.rail.drag.sx+(b.clientX-a.rail.drag.x);0>a.scroll.x&&(a.scroll.x=0);var c=a.scrollvaluemaxw;a.scroll.x>c&&(a.scroll.x=c)}else a.scroll.y=a.rail.drag.sy+(b.clientY-a.rail.drag.y),0>a.scroll.y&&(a.scroll.y=0),c=a.scrollvaluemax,a.scroll.y>c&&(a.scroll.y=
-c);a.synched("mousemove",function(){a.rail.drag&&1==a.rail.drag.pt&&(a.showCursor(),a.rail.drag.hr?a.hasreversehr?a.doScrollLeft(a.scrollvaluemaxw-Math.round(a.scroll.x*a.scrollratio.x),a.opt.cursordragspeed):a.doScrollLeft(Math.round(a.scroll.x*a.scrollratio.x),a.opt.cursordragspeed):a.doScrollTop(Math.round(a.scroll.y*a.scrollratio.y),a.opt.cursordragspeed))});return a.cancelEvent(b)}}else a.checkarea=0};if(e.cantouch||a.opt.touchbehavior)a.onpreventclick=function(b){if(a.preventclick)return a.preventclick.tg.onclick=
-a.preventclick.click,a.preventclick=!1,a.cancelEvent(b)},a.bind(a.win,"mousedown",a.ontouchstart),a.onclick=e.isios?!1:function(b){return a.lastmouseup?(a.lastmouseup=!1,a.cancelEvent(b)):!0},a.opt.grabcursorenabled&&e.cursorgrabvalue&&(a.css(a.ispage?a.doc:a.win,{cursor:e.cursorgrabvalue}),a.css(a.rail,{cursor:e.cursorgrabvalue}));else{var r=function(b){if(a.selectiondrag){if(b){var c=a.win.outerHeight();b=b.pageY-a.selectiondrag.top;0<b&&b<c&&(b=0);b>=c&&(b-=c);a.selectiondrag.df=b}0!=a.selectiondrag.df&&
-(a.doScrollBy(2*-Math.floor(a.selectiondrag.df/6)),function () {})}};a.hasTextSelected="getSelection"in document?function(){return 0<document.getSelection().rangeCount}:"selection"in document?function(){return"None"!=document.selection.type}:function(){return!1};a.onselectionstart=function(b){a.ispage||(a.selectiondrag=a.win.offset())};a.onselectionend=function(b){a.selectiondrag=!1};a.onselectiondrag=function(b){a.selectiondrag&&a.hasTextSelected()&&a.debounced("selectionscroll",
-function(){r(b)},250)}}e.hasw3ctouch?(a.css(a.rail,{"touch-action":"none"}),a.css(a.cursor,{"touch-action":"none"}),a.bind(a.win,"pointerdown",a.ontouchstart),a.bind(document,"pointerup",a.ontouchend),a.bind(document,"pointermove",a.ontouchmove)):e.hasmstouch?(a.css(a.rail,{"-ms-touch-action":"none"}),a.css(a.cursor,{"-ms-touch-action":"none"}),a.bind(a.win,"MSPointerDown",a.ontouchstart),a.bind(document,"MSPointerUp",a.ontouchend),a.bind(document,"MSPointerMove",a.ontouchmove),a.bind(a.cursor,"MSGestureHold",
-function(a){a.preventDefault()}),a.bind(a.cursor,"contextmenu",function(a){a.preventDefault()})):this.istouchcapable&&(a.bind(a.win,"touchstart",a.ontouchstart),a.bind(document,"touchend",a.ontouchend),a.bind(document,"touchcancel",a.ontouchend),a.bind(document,"touchmove",a.ontouchmove));if(a.opt.cursordragontouch||!e.cantouch&&!a.opt.touchbehavior)a.rail.css({cursor:"default"}),a.railh&&a.railh.css({cursor:"default"}),a.jqbind(a.rail,"mouseenter",function(){if(!a.ispage&&!a.win.is(":visible"))return!1;
-a.canshowonmouseevent&&a.showCursor();a.rail.active=!0}),a.jqbind(a.rail,"mouseleave",function(){a.rail.active=!1;a.rail.drag||a.hideCursor()}),a.opt.sensitiverail&&(a.bind(a.rail,"click",function(b){a.doRailClick(b,!1,!1)}),a.bind(a.rail,"dblclick",function(b){a.doRailClick(b,!0,!1)}),a.bind(a.cursor,"click",function(b){a.cancelEvent(b)}),a.bind(a.cursor,"dblclick",function(b){a.cancelEvent(b)})),a.railh&&(a.jqbind(a.railh,"mouseenter",function(){if(!a.ispage&&!a.win.is(":visible"))return!1;a.canshowonmouseevent&&
-a.showCursor();a.rail.active=!0}),a.jqbind(a.railh,"mouseleave",function(){a.rail.active=!1;a.rail.drag||a.hideCursor()}),a.opt.sensitiverail&&(a.bind(a.railh,"click",function(b){a.doRailClick(b,!1,!0)}),a.bind(a.railh,"dblclick",function(b){a.doRailClick(b,!0,!0)}),a.bind(a.cursorh,"click",function(b){a.cancelEvent(b)}),a.bind(a.cursorh,"dblclick",function(b){a.cancelEvent(b)})));e.cantouch||a.opt.touchbehavior?(a.bind(e.hasmousecapture?a.win:document,"mouseup",a.ontouchend),a.bind(document,"mousemove",
-a.ontouchmove),a.onclick&&a.bind(document,"click",a.onclick),a.opt.cursordragontouch?(a.bind(a.cursor,"mousedown",a.onmousedown),a.bind(a.cursor,"mouseup",a.onmouseup),a.cursorh&&a.bind(a.cursorh,"mousedown",function(b){a.onmousedown(b,!0)}),a.cursorh&&a.bind(a.cursorh,"mouseup",a.onmouseup)):(a.bind(a.rail,"mousedown",function(a){a.preventDefault()}),a.railh&&a.bind(a.railh,"mousedown",function(a){a.preventDefault()}))):(a.bind(e.hasmousecapture?a.win:document,"mouseup",a.onmouseup),a.bind(document,
-"mousemove",a.onmousemove),a.onclick&&a.bind(document,"click",a.onclick),a.bind(a.cursor,"mousedown",a.onmousedown),a.bind(a.cursor,"mouseup",a.onmouseup),a.railh&&(a.bind(a.cursorh,"mousedown",function(b){a.onmousedown(b,!0)}),a.bind(a.cursorh,"mouseup",a.onmouseup)),!a.ispage&&a.opt.enablescrollonselection&&(a.bind(a.win[0],"mousedown",a.onselectionstart),a.bind(document,"mouseup",a.onselectionend),a.bind(a.cursor,"mouseup",a.onselectionend),a.cursorh&&a.bind(a.cursorh,"mouseup",a.onselectionend),
-a.bind(document,"mousemove",a.onselectiondrag)),a.zoom&&(a.jqbind(a.zoom,"mouseenter",function(){a.canshowonmouseevent&&a.showCursor();a.rail.active=!0}),a.jqbind(a.zoom,"mouseleave",function(){a.rail.active=!1;a.rail.drag||a.hideCursor()})));a.opt.enablemousewheel&&(a.isiframe||a.mousewheel(e.isie&&a.ispage?document:a.win,a.onmousewheel),a.mousewheel(a.rail,a.onmousewheel),a.railh&&a.mousewheel(a.railh,a.onmousewheelhr));a.ispage||e.cantouch||/HTML|^BODY/.test(a.win[0].nodeName)||(a.win.attr("tabindex")||
-a.win.attr({tabindex:O++}),a.jqbind(a.win,"focus",function(b){B=a.getTarget(b).id||!0;a.hasfocus=!0;a.canshowonmouseevent&&a.noticeCursor()}),a.jqbind(a.win,"blur",function(b){B=!1;a.hasfocus=!1}),a.jqbind(a.win,"mouseenter",function(b){F=a.getTarget(b).id||!0;a.hasmousefocus=!0;a.canshowonmouseevent&&a.noticeCursor()}),a.jqbind(a.win,"mouseleave",function(){F=!1;a.hasmousefocus=!1;a.rail.drag||a.hideCursor()}))}a.onkeypress=function(b){if(a.railslocked&&0==a.page.maxh)return!0;b=b?b:window.e;var c=
-a.getTarget(b);if(c&&/INPUT|TEXTAREA|SELECT|OPTION/.test(c.nodeName)&&(!c.getAttribute("type")&&!c.type||!/submit|button|cancel/i.tp)||f(c).attr("contenteditable"))return!0;if(a.hasfocus||a.hasmousefocus&&!B||a.ispage&&!B&&!F){c=b.keyCode;if(a.railslocked&&27!=c)return a.cancelEvent(b);var g=b.ctrlKey||!1,d=b.shiftKey||!1,e=!1;switch(c){case 38:case 63233:a.doScrollBy(72);e=!0;break;case 40:case 63235:a.doScrollBy(-72);e=!0;break;case 37:case 63232:a.railh&&(g?a.doScrollLeft(0):a.doScrollLeftBy(72),
-e=!0);break;case 39:case 63234:a.railh&&(g?a.doScrollLeft(a.page.maxw):a.doScrollLeftBy(-72),e=!0);break;case 33:case 63276:a.doScrollBy(a.view.h);e=!0;break;case 34:case 63277:a.doScrollBy(-a.view.h);e=!0;break;case 36:case 63273:a.railh&&g?a.doScrollPos(0,0):a.doScrollTo(0);e=!0;break;case 35:case 63275:a.railh&&g?a.doScrollPos(a.page.maxw,a.page.maxh):a.doScrollTo(a.page.maxh);e=!0;break;case 32:a.opt.spacebarenabled&&(d?a.doScrollBy(a.view.h):a.doScrollBy(-a.view.h),e=!0);break;case 27:a.zoomactive&&
-(a.doZoom(),e=!0)}if(e)return a.cancelEvent(b)}};a.opt.enablekeyboard&&a.bind(document,e.isopera&&!e.isopera12?"keypress":"keydown",a.onkeypress);a.bind(document,"keydown",function(b){b.ctrlKey&&(a.wheelprevented=!0)});a.bind(document,"keyup",function(b){b.ctrlKey||(a.wheelprevented=!1)});a.bind(window,"blur",function(b){a.wheelprevented=!1});a.bind(window,"resize",a.lazyResize);a.bind(window,"orientationchange",a.lazyResize);a.bind(window,"load",a.lazyResize);if(e.ischrome&&!a.ispage&&!a.haswrapper){var t=
-a.win.attr("style"),m=parseFloat(a.win.css("width"))+1;a.win.css("width",m);a.synched("chromefix",function(){a.win.attr("style",t)})}a.onAttributeChange=function(b){a.lazyResize(a.isieold?250:30)};a.isie11||!1===x||(a.observerbody=new x(function(b){b.forEach(function(b){if("attributes"==b.type)return f("body").hasClass("modal-open")&&f("body").hasClass("modal-dialog")&&!f.contains(f(".modal-dialog")[0],a.doc[0])?a.hide():a.show()});if(document.body.scrollHeight!=a.page.maxh)return a.lazyResize(30)}),
-a.observerbody.observe(document.body,{childList:!0,subtree:!0,characterData:!1,attributes:!0,attributeFilter:["class"]}));a.ispage||a.haswrapper||(!1!==x?(a.observer=new x(function(b){b.forEach(a.onAttributeChange)}),a.observer.observe(a.win[0],{childList:!0,characterData:!1,attributes:!0,subtree:!1}),a.observerremover=new x(function(b){b.forEach(function(b){if(0<b.removedNodes.length)for(var c in b.removedNodes)if(a&&b.removedNodes[c]==a.win[0])return a.remove()})}),a.observerremover.observe(a.win[0].parentNode,
-{childList:!0,characterData:!1,attributes:!1,subtree:!1})):(a.bind(a.win,e.isie&&!e.isie9?"propertychange":"DOMAttrModified",a.onAttributeChange),e.isie9&&a.win[0].attachEvent("onpropertychange",a.onAttributeChange),a.bind(a.win,"DOMNodeRemoved",function(b){b.target==a.win[0]&&a.remove()})));!a.ispage&&a.opt.boxzoom&&a.bind(window,"resize",a.resizeZoom);a.istextarea&&(a.bind(a.win,"keydown",a.lazyResize),a.bind(a.win,"mouseup",a.lazyResize));a.lazyResize(30)}if("IFRAME"==this.doc[0].nodeName){var N=
-function(){a.iframexd=!1;var c;try{c="contentDocument"in this?this.contentDocument:this.contentWindow.document}catch(g){a.iframexd=!0,c=!1}if(a.iframexd)return"console"in window&&console.log("NiceScroll error: policy restriced iframe"),!0;a.forcescreen=!0;a.isiframe&&(a.iframe={doc:f(c),html:a.doc.contents().find("html")[0],body:a.doc.contents().find("body")[0]},a.getContentSize=function(){return{w:Math.max(a.iframe.html.scrollWidth,a.iframe.body.scrollWidth),h:Math.max(a.iframe.html.scrollHeight,
-a.iframe.body.scrollHeight)}},a.docscroll=f(a.iframe.body));if(!e.isios&&a.opt.iframeautoresize&&!a.isiframe){a.win.scrollTop(0);a.doc.height("");var d=Math.max(c.getElementsByTagName("html")[0].scrollHeight,c.body.scrollHeight);a.doc.height(d)}a.lazyResize(30);e.isie7&&a.css(f(a.iframe.html),b);a.css(f(a.iframe.body),b);e.isios&&a.haswrapper&&a.css(f(c.body),{"-webkit-transform":"translate3d(0,0,0)"});"contentWindow"in this?a.bind(this.contentWindow,"scroll",a.onscroll):a.bind(c,"scroll",a.onscroll);
-a.opt.enablemousewheel&&a.mousewheel(c,a.onmousewheel);a.opt.enablekeyboard&&a.bind(c,e.isopera?"keypress":"keydown",a.onkeypress);if(e.cantouch||a.opt.touchbehavior)a.bind(c,"mousedown",a.ontouchstart),a.bind(c,"mousemove",function(b){return a.ontouchmove(b,!0)}),a.opt.grabcursorenabled&&e.cursorgrabvalue&&a.css(f(c.body),{cursor:e.cursorgrabvalue});a.bind(c,"mouseup",a.ontouchend);a.zoom&&(a.opt.dblclickzoom&&a.bind(c,"dblclick",a.doZoom),a.ongesturezoom&&a.bind(c,"gestureend",a.ongesturezoom))};
-this.doc[0].readyState&&"complete"==this.doc[0].readyState&&setTimeout(function(){N.call(a.doc[0],!1)},500);a.bind(this.doc,"load",N)}};this.showCursor=function(b,c){a.cursortimeout&&(clearTimeout(a.cursortimeout),a.cursortimeout=0);if(a.rail){a.autohidedom&&(a.autohidedom.stop().css({opacity:a.opt.cursoropacitymax}),a.cursoractive=!0);a.rail.drag&&1==a.rail.drag.pt||(void 0!==b&&!1!==b&&(a.scroll.y=Math.round(1*b/a.scrollratio.y)),void 0!==c&&(a.scroll.x=Math.round(1*c/a.scrollratio.x)));a.cursor.css({height:a.cursorheight,
-top:a.scroll.y});if(a.cursorh){var d=a.hasreversehr?a.scrollvaluemaxw-a.scroll.x:a.scroll.x;!a.rail.align&&a.rail.visibility?a.cursorh.css({width:a.cursorwidth,left:d+a.rail.width}):a.cursorh.css({width:a.cursorwidth,left:d});a.cursoractive=!0}a.zoom&&a.zoom.stop().css({opacity:a.opt.cursoropacitymax})}};this.hideCursor=function(b){a.cursortimeout||!a.rail||!a.autohidedom||a.hasmousefocus&&"leave"==a.opt.autohidemode||(a.cursortimeout=setTimeout(function(){a.rail.active&&a.showonmouseevent||(a.autohidedom.stop().animate({opacity:a.opt.cursoropacitymin}),
-a.zoom&&a.zoom.stop().animate({opacity:a.opt.cursoropacitymin}),a.cursoractive=!1);a.cursortimeout=0},b||a.opt.hidecursordelay))};this.noticeCursor=function(b,c,d){a.showCursor(c,d);a.rail.active||a.hideCursor(b)};this.getContentSize=a.ispage?function(){return{w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth),h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)}}:a.haswrapper?function(){return{w:a.doc.outerWidth()+parseInt(a.win.css("paddingLeft"))+
-parseInt(a.win.css("paddingRight")),h:a.doc.outerHeight()+parseInt(a.win.css("paddingTop"))+parseInt(a.win.css("paddingBottom"))}}:function(){return{w:a.docscroll[0].scrollWidth,h:a.docscroll[0].scrollHeight}};this.onResize=function(b,c){if(!a||!a.win)return!1;if(!a.haswrapper&&!a.ispage){if("none"==a.win.css("display"))return a.visibility&&a.hideRail().hideRailHr(),!1;a.hidden||a.visibility||a.showRail().showRailHr()}var d=a.page.maxh,e=a.page.maxw,f=a.view.h,k=a.view.w;a.view={w:a.ispage?a.win.width():
-parseInt(a.win[0].clientWidth),h:a.ispage?a.win.height():parseInt(a.win[0].clientHeight)};a.page=c?c:a.getContentSize();a.page.maxh=Math.max(0,a.page.h-a.view.h);a.page.maxw=Math.max(0,a.page.w-a.view.w);if(a.page.maxh==d&&a.page.maxw==e&&a.view.w==k&&a.view.h==f){if(a.ispage)return a;d=a.win.offset();if(a.lastposition&&(e=a.lastposition,e.top==d.top&&e.left==d.left))return a;a.lastposition=d}0==a.page.maxh?(a.hideRail(),a.scrollvaluemax=0,a.scroll.y=0,a.scrollratio.y=0,a.cursorheight=0,a.setScrollTop(0),
-a.rail&&(a.rail.scrollable=!1)):(a.page.maxh-=a.opt.railpadding.top+a.opt.railpadding.bottom,a.rail.scrollable=!0);0==a.page.maxw?(a.hideRailHr(),a.scrollvaluemaxw=0,a.scroll.x=0,a.scrollratio.x=0,a.cursorwidth=0,a.setScrollLeft(0),a.railh&&(a.railh.scrollable=!1)):(a.page.maxw-=a.opt.railpadding.left+a.opt.railpadding.right,a.railh&&(a.railh.scrollable=a.opt.horizrailenabled));a.railslocked=a.locked||0==a.page.maxh&&0==a.page.maxw;if(a.railslocked)return a.ispage||a.updateScrollBar(a.view),!1;a.hidden||
-a.visibility?!a.railh||a.hidden||a.railh.visibility||a.showRailHr():a.showRail().showRailHr();a.istextarea&&a.win.css("resize")&&"none"!=a.win.css("resize")&&(a.view.h-=20);a.cursorheight=Math.min(a.view.h,Math.round(a.view.h/a.page.h*a.view.h));a.cursorheight=a.opt.cursorfixedheight?a.opt.cursorfixedheight:Math.max(a.opt.cursorminheight,a.cursorheight);a.cursorwidth=Math.min(a.view.w,Math.round(a.view.w/a.page.w*a.view.w));a.cursorwidth=a.opt.cursorfixedheight?a.opt.cursorfixedheight:Math.max(a.opt.cursorminheight,
-a.cursorwidth);a.scrollvaluemax=a.view.h-a.cursorheight-a.cursor.hborder-(a.opt.railpadding.top+a.opt.railpadding.bottom);a.railh&&(a.railh.width=0<a.page.maxh?a.view.w-a.rail.width:a.view.w,a.scrollvaluemaxw=a.railh.width-a.cursorwidth-a.cursorh.wborder-(a.opt.railpadding.left+a.opt.railpadding.right));a.ispage||a.updateScrollBar(a.view);a.scrollratio={x:a.page.maxw/a.scrollvaluemaxw,y:a.page.maxh/a.scrollvaluemax};a.getScrollTop()>a.page.maxh?a.doScrollTop(a.page.maxh):(a.scroll.y=Math.round(a.getScrollTop()*
-(1/a.scrollratio.y)),a.scroll.x=Math.round(a.getScrollLeft()*(1/a.scrollratio.x)),a.cursoractive&&a.noticeCursor());a.scroll.y&&0==a.getScrollTop()&&a.doScrollTo(Math.floor(a.scroll.y*a.scrollratio.y));return a};this.resize=a.onResize;this.hlazyresize=0;this.lazyResize=function(b){a.haswrapper||a.hide();a.hlazyresize&&clearTimeout(a.hlazyresize);a.hlazyresize=setTimeout(function(){a&&a.show().resize()},240);return a};this.jqbind=function(b,c,d){a.events.push({e:b,n:c,f:d,q:!0});f(b).bind(c,d)};this.mousewheel=
-function(b,c,d){b="jquery"in b?b[0]:b;if("onwheel"in document.createElement("div"))a._bind(b,"wheel",c,d||!1);else{var e=void 0!==document.onmousewheel?"mousewheel":"DOMMouseScroll";q(b,e,c,d||!1);"DOMMouseScroll"==e&&q(b,"MozMousePixelScroll",c,d||!1)}};e.haseventlistener?(this.bind=function(b,c,d,e){a._bind("jquery"in b?b[0]:b,c,d,e||!1)},this._bind=function(b,c,d,e){a.events.push({e:b,n:c,f:d,b:e,q:!1});b.addEventListener(c,d,e||!1)},this.cancelEvent=function(a){if(!a)return!1;a=a.original?a.original:
-a;a.cancelable&&a.preventDefault();a.stopPropagation();a.preventManipulation&&a.preventManipulation();return!1},this.stopPropagation=function(a){if(!a)return!1;a=a.original?a.original:a;a.stopPropagation();return!1},this._unbind=function(a,c,d,e){a.removeEventListener(c,d,e)}):(this.bind=function(b,c,d,e){var f="jquery"in b?b[0]:b;a._bind(f,c,function(b){(b=b||window.event||!1)&&b.srcElement&&(b.target=b.srcElement);"pageY"in b||(b.pageX=b.clientX+document.documentElement.scrollLeft,b.pageY=b.clientY+
-document.documentElement.scrollTop);return!1===d.call(f,b)||!1===e?a.cancelEvent(b):!0})},this._bind=function(b,c,d,e){a.events.push({e:b,n:c,f:d,b:e,q:!1});b.attachEvent?b.attachEvent("on"+c,d):b["on"+c]=d},this.cancelEvent=function(a){a=window.event||!1;if(!a)return!1;a.cancelBubble=!0;a.cancel=!0;return a.returnValue=!1},this.stopPropagation=function(a){a=window.event||!1;if(!a)return!1;a.cancelBubble=!0;return!1},this._unbind=function(a,c,d,e){a.detachEvent?a.detachEvent("on"+c,d):a["on"+c]=!1});
-this.unbindAll=function(){for(var b=0;b<a.events.length;b++){var c=a.events[b];c.q?c.e.unbind(c.n,c.f):a._unbind(c.e,c.n,c.f,c.b)}};this.showRail=function(){0==a.page.maxh||!a.ispage&&"none"==a.win.css("display")||(a.visibility=!0,a.rail.visibility=!0,a.rail.css("display","block"));return a};this.showRailHr=function(){if(!a.railh)return a;0==a.page.maxw||!a.ispage&&"none"==a.win.css("display")||(a.railh.visibility=!0,a.railh.css("display","block"));return a};this.hideRail=function(){a.visibility=
-!1;a.rail.visibility=!1;a.rail.css("display","none");return a};this.hideRailHr=function(){if(!a.railh)return a;a.railh.visibility=!1;a.railh.css("display","none");return a};this.show=function(){a.hidden=!1;a.railslocked=!1;return a.showRail().showRailHr()};this.hide=function(){a.hidden=!0;a.railslocked=!0;return a.hideRail().hideRailHr()};this.toggle=function(){return a.hidden?a.show():a.hide()};this.remove=function(){a.stop();a.cursortimeout&&clearTimeout(a.cursortimeout);for(var b in a.delaylist)a.delaylist[b]&&
-w(a.delaylist[b].h);a.doZoomOut();a.unbindAll();e.isie9&&a.win[0].detachEvent("onpropertychange",a.onAttributeChange);!1!==a.observer&&a.observer.disconnect();!1!==a.observerremover&&a.observerremover.disconnect();!1!==a.observerbody&&a.observerbody.disconnect();a.events=null;a.cursor&&a.cursor.remove();a.cursorh&&a.cursorh.remove();a.rail&&a.rail.remove();a.railh&&a.railh.remove();a.zoom&&a.zoom.remove();for(b=0;b<a.saved.css.length;b++){var c=a.saved.css[b];c[0].css(c[1],void 0===c[2]?"":c[2])}a.saved=
-!1;a.me.data("__nicescroll","");var d=f.nicescroll;d.each(function(b){if(this&&this.id===a.id){delete d[b];for(var c=++b;c<d.length;c++,b++)d[b]=d[c];d.length--;d.length&&delete d[d.length]}});for(var k in a)a[k]=null,delete a[k];a=null};this.scrollstart=function(b){this.onscrollstart=b;return a};this.scrollend=function(b){this.onscrollend=b;return a};this.scrollcancel=function(b){this.onscrollcancel=b;return a};this.zoomin=function(b){this.onzoomin=b;return a};this.zoomout=function(b){this.onzoomout=
-b;return a};this.isScrollable=function(a){a=a.target?a.target:a;if("OPTION"==a.nodeName)return!0;for(;a&&1==a.nodeType&&!/^BODY|HTML/.test(a.nodeName);){var c=f(a),c=c.css("overflowY")||c.css("overflowX")||c.css("overflow")||"";if(/scroll|auto/.test(c))return a.clientHeight!=a.scrollHeight;a=a.parentNode?a.parentNode:!1}return!1};this.getViewport=function(a){for(a=a&&a.parentNode?a.parentNode:!1;a&&1==a.nodeType&&!/^BODY|HTML/.test(a.nodeName);){var c=f(a);if(/fixed|absolute/.test(c.css("position")))return c;
-var d=c.css("overflowY")||c.css("overflowX")||c.css("overflow")||"";if(/scroll|auto/.test(d)&&a.clientHeight!=a.scrollHeight||0<c.getNiceScroll().length)return c;a=a.parentNode?a.parentNode:!1}return!1};this.triggerScrollEnd=function(){if(a.onscrollend){var b=a.getScrollLeft(),c=a.getScrollTop();a.onscrollend.call(a,{type:"scrollend",current:{x:b,y:c},end:{x:b,y:c}})}};this.onmousewheel=function(b){if(!a.wheelprevented){if(a.railslocked)return a.debounced("checkunlock",a.resize,250),!0;if(a.rail.drag)return a.cancelEvent(b);
-"auto"==a.opt.oneaxismousemode&&0!=b.deltaX&&(a.opt.oneaxismousemode=!1);if(a.opt.oneaxismousemode&&0==b.deltaX&&!a.rail.scrollable)return a.railh&&a.railh.scrollable?a.onmousewheelhr(b):!0;var c=+new Date,d=!1;a.opt.preservenativescrolling&&a.checkarea+600<c&&(a.nativescrollingarea=a.isScrollable(b),d=!0);a.checkarea=c;if(a.nativescrollingarea)return!0;if(b=t(b,!1,d))a.checkarea=0;return b}};this.onmousewheelhr=function(b){if(!a.wheelprevented){if(a.railslocked||!a.railh.scrollable)return!0;if(a.rail.drag)return a.cancelEvent(b);
-var c=+new Date,d=!1;a.opt.preservenativescrolling&&a.checkarea+600<c&&(a.nativescrollingarea=a.isScrollable(b),d=!0);a.checkarea=c;return a.nativescrollingarea?!0:a.railslocked?a.cancelEvent(b):t(b,!0,d)}};this.stop=function(){a.cancelScroll();a.scrollmon&&a.scrollmon.stop();a.cursorfreezed=!1;a.scroll.y=Math.round(a.getScrollTop()*(1/a.scrollratio.y));a.noticeCursor();return a};this.getTransitionSpeed=function(b){b=Math.min(Math.round(10*a.opt.scrollspeed),Math.round(b/20*a.opt.scrollspeed));return 20<
-b?b:0};a.opt.smoothscroll?a.ishwscroll&&e.hastransition&&a.opt.usetransition&&a.opt.smoothscroll?(this.prepareTransition=function(b,c){var d=c?20<b?b:0:a.getTransitionSpeed(b),f=d?e.prefixstyle+"transform "+d+"ms ease-out":"";a.lasttransitionstyle&&a.lasttransitionstyle==f||(a.lasttransitionstyle=f,a.doc.css(e.transitionstyle,f));return d},this.doScrollLeft=function(b,c){var d=a.scrollrunning?a.newscrolly:a.getScrollTop();a.doScrollPos(b,d,c)},this.doScrollTop=function(b,c){var d=a.scrollrunning?
-a.newscrollx:a.getScrollLeft();a.doScrollPos(d,b,c)},this.doScrollPos=function(b,c,d){var f=a.getScrollTop(),k=a.getScrollLeft();(0>(a.newscrolly-f)*(c-f)||0>(a.newscrollx-k)*(b-k))&&a.cancelScroll();0==a.opt.bouncescroll&&(0>c?c=0:c>a.page.maxh&&(c=a.page.maxh),0>b?b=0:b>a.page.maxw&&(b=a.page.maxw));if(a.scrollrunning&&b==a.newscrollx&&c==a.newscrolly)return!1;a.newscrolly=c;a.newscrollx=b;a.newscrollspeed=d||!1;if(a.timer)return!1;a.timer=setTimeout(function(){var d=a.getScrollTop(),f=a.getScrollLeft(),
-k=Math.round(Math.sqrt(Math.pow(b-f,2)+Math.pow(c-d,2))),k=a.newscrollspeed&&1<a.newscrollspeed?a.newscrollspeed:a.getTransitionSpeed(k);a.newscrollspeed&&1>=a.newscrollspeed&&(k*=a.newscrollspeed);a.prepareTransition(k,!0);a.timerscroll&&a.timerscroll.tm&&clearInterval(a.timerscroll.tm);0<k&&(!a.scrollrunning&&a.onscrollstart&&a.onscrollstart.call(a,{type:"scrollstart",current:{x:f,y:d},request:{x:b,y:c},end:{x:a.newscrollx,y:a.newscrolly},speed:k}),e.transitionend?a.scrollendtrapped||(a.scrollendtrapped=
-!0,a.bind(a.doc,e.transitionend,a.onScrollTransitionEnd,!1)):(a.scrollendtrapped&&clearTimeout(a.scrollendtrapped),a.scrollendtrapped=setTimeout(a.onScrollTransitionEnd,k)),a.timerscroll={bz:new D(d,a.newscrolly,k,0,0,.58,1),bh:new D(f,a.newscrollx,k,0,0,.58,1)},a.cursorfreezed||(a.timerscroll.tm=setInterval(function(){a.showCursor(a.getScrollTop(),a.getScrollLeft())},60)));a.synched("doScroll-set",function(){a.timer=0;a.scrollendtrapped&&(a.scrollrunning=!0);a.setScrollTop(a.newscrolly);a.setScrollLeft(a.newscrollx);
-if(!a.scrollendtrapped)a.onScrollTransitionEnd()})},50)},this.cancelScroll=function(){if(!a.scrollendtrapped)return!0;var b=a.getScrollTop(),c=a.getScrollLeft();a.scrollrunning=!1;e.transitionend||clearTimeout(e.transitionend);a.scrollendtrapped=!1;a._unbind(a.doc[0],e.transitionend,a.onScrollTransitionEnd);a.prepareTransition(0);a.setScrollTop(b);a.railh&&a.setScrollLeft(c);a.timerscroll&&a.timerscroll.tm&&clearInterval(a.timerscroll.tm);a.timerscroll=!1;a.cursorfreezed=!1;a.showCursor(b,c);return a},
-this.onScrollTransitionEnd=function(){a.scrollendtrapped&&a._unbind(a.doc[0],e.transitionend,a.onScrollTransitionEnd);a.scrollendtrapped=!1;a.prepareTransition(0);a.timerscroll&&a.timerscroll.tm&&clearInterval(a.timerscroll.tm);a.timerscroll=!1;var b=a.getScrollTop(),c=a.getScrollLeft();a.setScrollTop(b);a.railh&&a.setScrollLeft(c);a.noticeCursor(!1,b,c);a.cursorfreezed=!1;0>b?b=0:b>a.page.maxh&&(b=a.page.maxh);0>c?c=0:c>a.page.maxw&&(c=a.page.maxw);if(b!=a.newscrolly||c!=a.newscrollx)return a.doScrollPos(c,
-b,a.opt.snapbackspeed);a.onscrollend&&a.scrollrunning&&a.triggerScrollEnd();a.scrollrunning=!1}):(this.doScrollLeft=function(b,c){var d=a.scrollrunning?a.newscrolly:a.getScrollTop();a.doScrollPos(b,d,c)},this.doScrollTop=function(b,c){var d=a.scrollrunning?a.newscrollx:a.getScrollLeft();a.doScrollPos(d,b,c)},this.doScrollPos=function(b,c,d){function e(){if(a.cancelAnimationFrame)return!0;a.scrollrunning=!0;if(p=1-p)return a.timer=v(e)||1;var b=0,c,d,f=d=a.getScrollTop();if(a.dst.ay){f=a.bzscroll?
-a.dst.py+a.bzscroll.getNow()*a.dst.ay:a.newscrolly;c=f-d;if(0>c&&f<a.newscrolly||0<c&&f>a.newscrolly)f=a.newscrolly;a.setScrollTop(f);f==a.newscrolly&&(b=1)}else b=1;d=c=a.getScrollLeft();if(a.dst.ax){d=a.bzscroll?a.dst.px+a.bzscroll.getNow()*a.dst.ax:a.newscrollx;c=d-c;if(0>c&&d<a.newscrollx||0<c&&d>a.newscrollx)d=a.newscrollx;a.setScrollLeft(d);d==a.newscrollx&&(b+=1)}else b+=1;2==b?(a.timer=0,a.cursorfreezed=!1,a.bzscroll=!1,a.scrollrunning=!1,0>f?f=0:f>a.page.maxh&&(f=Math.max(0,a.page.maxh)),
-0>d?d=0:d>a.page.maxw&&(d=a.page.maxw),d!=a.newscrollx||f!=a.newscrolly?a.doScrollPos(d,f):a.onscrollend&&a.triggerScrollEnd()):a.timer=v(e)||1}c=void 0===c||!1===c?a.getScrollTop(!0):c;if(a.timer&&a.newscrolly==c&&a.newscrollx==b)return!0;a.timer&&w(a.timer);a.timer=0;var f=a.getScrollTop(),k=a.getScrollLeft();(0>(a.newscrolly-f)*(c-f)||0>(a.newscrollx-k)*(b-k))&&a.cancelScroll();a.newscrolly=c;a.newscrollx=b;a.bouncescroll&&a.rail.visibility||(0>a.newscrolly?a.newscrolly=0:a.newscrolly>a.page.maxh&&
-(a.newscrolly=a.page.maxh));a.bouncescroll&&a.railh.visibility||(0>a.newscrollx?a.newscrollx=0:a.newscrollx>a.page.maxw&&(a.newscrollx=a.page.maxw));a.dst={};a.dst.x=b-k;a.dst.y=c-f;a.dst.px=k;a.dst.py=f;var h=Math.round(Math.sqrt(Math.pow(a.dst.x,2)+Math.pow(a.dst.y,2)));a.dst.ax=a.dst.x/h;a.dst.ay=a.dst.y/h;var l=0,n=h;0==a.dst.x?(l=f,n=c,a.dst.ay=1,a.dst.py=0):0==a.dst.y&&(l=k,n=b,a.dst.ax=1,a.dst.px=0);h=a.getTransitionSpeed(h);d&&1>=d&&(h*=d);a.bzscroll=0<h?a.bzscroll?a.bzscroll.update(n,h):
-new D(l,n,h,0,1,0,1):!1;if(!a.timer){(f==a.page.maxh&&c>=a.page.maxh||k==a.page.maxw&&b>=a.page.maxw)&&a.checkContentSize();var p=1;a.cancelAnimationFrame=!1;a.timer=1;a.onscrollstart&&!a.scrollrunning&&a.onscrollstart.call(a,{type:"scrollstart",current:{x:k,y:f},request:{x:b,y:c},end:{x:a.newscrollx,y:a.newscrolly},speed:h});e();(f==a.page.maxh&&c>=f||k==a.page.maxw&&b>=k)&&a.checkContentSize();a.noticeCursor()}},this.cancelScroll=function(){a.timer&&w(a.timer);a.timer=0;a.bzscroll=!1;a.scrollrunning=
-!1;return a}):(this.doScrollLeft=function(b,c){var d=a.getScrollTop();a.doScrollPos(b,d,c)},this.doScrollTop=function(b,c){var d=a.getScrollLeft();a.doScrollPos(d,b,c)},this.doScrollPos=function(b,c,d){var e=b>a.page.maxw?a.page.maxw:b;0>e&&(e=0);var f=c>a.page.maxh?a.page.maxh:c;0>f&&(f=0);a.synched("scroll",function(){a.setScrollTop(f);a.setScrollLeft(e)})},this.cancelScroll=function(){});this.doScrollBy=function(b,c){var d=0,d=c?Math.floor((a.scroll.y-b)*a.scrollratio.y):(a.timer?a.newscrolly:
-a.getScrollTop(!0))-b;if(a.bouncescroll){var e=Math.round(a.view.h/2);d<-e?d=-e:d>a.page.maxh+e&&(d=a.page.maxh+e)}a.cursorfreezed=!1;e=a.getScrollTop(!0);if(0>d&&0>=e)return a.noticeCursor();if(d>a.page.maxh&&e>=a.page.maxh)return a.checkContentSize(),a.noticeCursor();a.doScrollTop(d)};this.doScrollLeftBy=function(b,c){var d=0,d=c?Math.floor((a.scroll.x-b)*a.scrollratio.x):(a.timer?a.newscrollx:a.getScrollLeft(!0))-b;if(a.bouncescroll){var e=Math.round(a.view.w/2);d<-e?d=-e:d>a.page.maxw+e&&(d=a.page.maxw+
-e)}a.cursorfreezed=!1;e=a.getScrollLeft(!0);if(0>d&&0>=e||d>a.page.maxw&&e>=a.page.maxw)return a.noticeCursor();a.doScrollLeft(d)};this.doScrollTo=function(b,c){a.cursorfreezed=!1;a.doScrollTop(b)};this.checkContentSize=function(){var b=a.getContentSize();b.h==a.page.h&&b.w==a.page.w||a.resize(!1,b)};a.onscroll=function(b){a.rail.drag||a.cursorfreezed||a.synched("scroll",function(){a.scroll.y=Math.round(a.getScrollTop()*(1/a.scrollratio.y));a.railh&&(a.scroll.x=Math.round(a.getScrollLeft()*(1/a.scrollratio.x)));
-a.noticeCursor()})};a.bind(a.docscroll,"scroll",a.onscroll);this.doZoomIn=function(b){if(!a.zoomactive){a.zoomactive=!0;a.zoomrestore={style:{}};var c="position top left zIndex backgroundColor marginTop marginBottom marginLeft marginRight".split(" "),d=a.win[0].style,k;for(k in c){var h=c[k];a.zoomrestore.style[h]=void 0!==d[h]?d[h]:""}a.zoomrestore.style.width=a.win.css("width");a.zoomrestore.style.height=a.win.css("height");a.zoomrestore.padding={w:a.win.outerWidth()-a.win.width(),h:a.win.outerHeight()-
-a.win.height()};e.isios4&&(a.zoomrestore.scrollTop=f(window).scrollTop(),f(window).scrollTop(0));a.win.css({position:e.isios4?"absolute":"fixed",top:0,left:0,zIndex:A+100,margin:0});c=a.win.css("backgroundColor");(""==c||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(c))&&a.win.css("backgroundColor","#fff");a.rail.css({zIndex:A+101});a.zoom.css({zIndex:A+102});a.zoom.css("backgroundPosition","0px -18px");a.resizeZoom();a.onzoomin&&a.onzoomin.call(a);return a.cancelEvent(b)}};this.doZoomOut=
-function(b){if(a.zoomactive)return a.zoomactive=!1,a.win.css("margin",""),a.win.css(a.zoomrestore.style),e.isios4&&f(window).scrollTop(a.zoomrestore.scrollTop),a.rail.css({"z-index":a.zindex}),a.zoom.css({"z-index":a.zindex}),a.zoomrestore=!1,a.zoom.css("backgroundPosition","0px 0px"),a.onResize(),a.onzoomout&&a.onzoomout.call(a),a.cancelEvent(b)};this.doZoom=function(b){return a.zoomactive?a.doZoomOut(b):a.doZoomIn(b)};this.resizeZoom=function(){if(a.zoomactive){var b=a.getScrollTop();a.win.css({width:f(window).width()-
-a.zoomrestore.padding.w+"px",height:f(window).height()-a.zoomrestore.padding.h+"px"});a.onResize();a.setScrollTop(Math.min(a.page.maxh,b))}};this.init();f.nicescroll.push(this)},M=function(f){var c=this;this.nc=f;this.steptime=this.lasttime=this.speedy=this.speedx=this.lasty=this.lastx=0;this.snapy=this.snapx=!1;this.demuly=this.demulx=0;this.lastscrolly=this.lastscrollx=-1;this.timer=this.chky=this.chkx=0;this.time=function(){return+new Date};this.reset=function(f,h){c.stop();var d=c.time();c.steptime=
-0;c.lasttime=d;c.speedx=0;c.speedy=0;c.lastx=f;c.lasty=h;c.lastscrollx=-1;c.lastscrolly=-1};this.update=function(f,h){var d=c.time();c.steptime=d-c.lasttime;c.lasttime=d;var d=h-c.lasty,q=f-c.lastx,t=c.nc.getScrollTop(),a=c.nc.getScrollLeft(),t=t+d,a=a+q;c.snapx=0>a||a>c.nc.page.maxw;c.snapy=0>t||t>c.nc.page.maxh;c.speedx=q;c.speedy=d;c.lastx=f;c.lasty=h};this.stop=function(){c.nc.unsynched("domomentum2d");c.timer&&clearTimeout(c.timer);c.timer=0;c.lastscrollx=-1;c.lastscrolly=-1};this.doSnapy=function(f,
-h){var d=!1;0>h?(h=0,d=!0):h>c.nc.page.maxh&&(h=c.nc.page.maxh,d=!0);0>f?(f=0,d=!0):f>c.nc.page.maxw&&(f=c.nc.page.maxw,d=!0);d?c.nc.doScrollPos(f,h,c.nc.opt.snapbackspeed):c.nc.triggerScrollEnd()};this.doMomentum=function(f){var h=c.time(),d=f?h+f:c.lasttime;f=c.nc.getScrollLeft();var q=c.nc.getScrollTop(),t=c.nc.page.maxh,a=c.nc.page.maxw;c.speedx=0<a?Math.min(60,c.speedx):0;c.speedy=0<t?Math.min(60,c.speedy):0;d=d&&60>=h-d;if(0>q||q>t||0>f||f>a)d=!1;f=c.speedx&&d?c.speedx:!1;if(c.speedy&&d&&c.speedy||
-f){var r=Math.max(16,c.steptime);50<r&&(f=r/50,c.speedx*=f,c.speedy*=f,r=50);c.demulxy=0;c.lastscrollx=c.nc.getScrollLeft();c.chkx=c.lastscrollx;c.lastscrolly=c.nc.getScrollTop();c.chky=c.lastscrolly;var p=c.lastscrollx,e=c.lastscrolly,v=function(){var d=600<c.time()-h?.04:.02;c.speedx&&(p=Math.floor(c.lastscrollx-c.speedx*(1-c.demulxy)),c.lastscrollx=p,0>p||p>a)&&(d=.1);c.speedy&&(e=Math.floor(c.lastscrolly-c.speedy*(1-c.demulxy)),c.lastscrolly=e,0>e||e>t)&&(d=.1);c.demulxy=Math.min(1,c.demulxy+
-d);c.nc.synched("domomentum2d",function(){c.speedx&&(c.nc.getScrollLeft(),c.chkx=p,c.nc.setScrollLeft(p));c.speedy&&(c.nc.getScrollTop(),c.chky=e,c.nc.setScrollTop(e));c.timer||(c.nc.hideCursor(),c.doSnapy(p,e))});1>c.demulxy?c.timer=setTimeout(v,r):(c.stop(),c.nc.hideCursor(),c.doSnapy(p,e))};v()}else c.doSnapy(c.nc.getScrollLeft(),c.nc.getScrollTop())}},y=f.fn.scrollTop;f.cssHooks.pageYOffset={get:function(h,c,k){return(c=f.data(h,"__nicescroll")||!1)&&c.ishwscroll?c.getScrollTop():y.call(h)},set:function(h,
-c){var k=f.data(h,"__nicescroll")||!1;k&&k.ishwscroll?k.setScrollTop(parseInt(c)):y.call(h,c);return this}};f.fn.scrollTop=function(h){if(void 0===h){var c=this[0]?f.data(this[0],"__nicescroll")||!1:!1;return c&&c.ishwscroll?c.getScrollTop():y.call(this)}return this.each(function(){var c=f.data(this,"__nicescroll")||!1;c&&c.ishwscroll?c.setScrollTop(parseInt(h)):y.call(f(this),h)})};var z=f.fn.scrollLeft;f.cssHooks.pageXOffset={get:function(h,c,k){return(c=f.data(h,"__nicescroll")||!1)&&c.ishwscroll?
-c.getScrollLeft():z.call(h)},set:function(h,c){var k=f.data(h,"__nicescroll")||!1;k&&k.ishwscroll?k.setScrollLeft(parseInt(c)):z.call(h,c);return this}};f.fn.scrollLeft=function(h){if(void 0===h){var c=this[0]?f.data(this[0],"__nicescroll")||!1:!1;return c&&c.ishwscroll?c.getScrollLeft():z.call(this)}return this.each(function(){var c=f.data(this,"__nicescroll")||!1;c&&c.ishwscroll?c.setScrollLeft(parseInt(h)):z.call(f(this),h)})};var E=function(h){var c=this;this.length=0;this.name="nicescrollarray";
-this.each=function(d){f.each(c,d);return c};this.push=function(d){c[c.length]=d;c.length++};this.eq=function(d){return c[d]};if(h)for(var k=0;k<h.length;k++){var l=f.data(h[k],"__nicescroll")||!1;l&&(this[this.length]=l,this.length++)}return this};(function(f,c,k){for(var l=0;l<c.length;l++)k(f,c[l])})(E.prototype,"show hide toggle onResize resize remove stop doScrollPos".split(" "),function(f,c){f[c]=function(){var f=arguments;return this.each(function(){this[c].apply(this,f)})}});f.fn.getNiceScroll=
-function(h){return void 0===h?new E(this):this[h]&&f.data(this[h],"__nicescroll")||!1};f.expr[":"].nicescroll=function(h){return void 0!==f.data(h,"__nicescroll")};f.fn.niceScroll=function(h,c){void 0!==c||"object"!=typeof h||"jquery"in h||(c=h,h=!1);c=f.extend({},c);var k=new E;void 0===c&&(c={});h&&(c.doc=f(h),c.win=f(this));var l=!("doc"in c);l||"win"in c||(c.win=f(this));this.each(function(){var d=f(this).data("__nicescroll")||!1;d||(c.doc=l?f(this):c.doc,d=new S(c,f(this)),f(this).data("__nicescroll",
-d));k.push(d)});return 1==k.length?k[0]:k};window.NiceScroll={getjQuery:function(){return f}};f.nicescroll||(f.nicescroll=new E,f.nicescroll.options=K)});

+ 3725 - 0
desktop/core/src/desktop/static/desktop/js/jquery.nicescroll.js

@@ -0,0 +1,3725 @@
+// Licensed to Cloudera, Inc. under one
+// or more contributor license agreements.  See the NOTICE file
+// distributed with this work for additional information
+// regarding copyright ownership.  Cloudera, Inc. licenses this file
+// to you under the Apache License, Version 2.0 (the
+// "License"); you may not use this file except in compliance
+// with the License.  You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+/* jquery.nicescroll
+-- version 3.6.8
+-- copyright 2016-02-29 InuYaksa*2016
+-- licensed under the MIT
+--
+-- http://nicescroll.areaaperta.com/
+-- https://github.com/inuyaksa/jquery.nicescroll
+--
+*/
+
+(function(factory) {
+  if (typeof define === 'function' && define.amd) {
+    // AMD. Register as anonymous module.
+    define(['jquery'], factory);
+  } else if (typeof exports === 'object') {
+    // Node/CommonJS.
+    module.exports = factory(require('jquery'));
+  } else {
+    // Browser globals.
+    factory(jQuery);
+  }
+}(function(jQuery) {
+  "use strict";
+
+  // globals
+  var domfocus = false;
+  var mousefocus = false;
+  var tabindexcounter = 0;
+  var ascrailcounter = 2000;
+  var globalmaxzindex = 0;
+
+  var $ = jQuery; // sandbox
+
+  // http://stackoverflow.com/questions/2161159/get-script-path
+  function getScriptPath() {
+    var scripts = document.getElementsByTagName('script');
+    var path = scripts.length ? scripts[scripts.length - 1].src.split('?')[0] : '';
+    return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
+  }
+
+  var vendors = ['webkit','ms','moz','o'];
+
+  var setAnimationFrame = window.requestAnimationFrame || false;
+  var clearAnimationFrame = window.cancelAnimationFrame || false;
+
+  if (!setAnimationFrame) {  // legacy detection
+    for (var vx in vendors) {
+      var v = vendors[vx];
+      setAnimationFrame = window[v + 'RequestAnimationFrame'];
+      if (setAnimationFrame) {
+        clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
+        break;
+      }
+    }
+  }
+
+  var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
+
+  var _globaloptions = {
+    zindex: "auto",
+    cursoropacitymin: 0,
+    cursoropacitymax: 1,
+    cursorcolor: "#424242",
+    cursorwidth: "6px",
+    cursorborder: "1px solid #fff",
+    cursorborderradius: "5px",
+    scrollspeed: 60,
+    mousescrollstep: 8 * 3,
+    touchbehavior: false,
+    hwacceleration: true,
+    usetransition: true,
+    boxzoom: false,
+    dblclickzoom: true,
+    gesturezoom: true,
+    grabcursorenabled: true,
+    autohidemode: true,
+    background: "",
+    iframeautoresize: true,
+    cursorminheight: 32,
+    preservenativescrolling: true,
+    railoffset: false,
+    railhoffset: false,
+    bouncescroll: true,
+    spacebarenabled: true,
+    railpadding: {
+      top: 0,
+      right: 0,
+      left: 0,
+      bottom: 0
+    },
+    disableoutline: true,
+    horizrailenabled: true,
+    railalign: "right",
+    railvalign: "bottom",
+    enabletranslate3d: true,
+    enablemousewheel: true,
+    enablekeyboard: true,
+    smoothscroll: true,
+    sensitiverail: true,
+    enablemouselockapi: true,
+    //      cursormaxheight:false,
+    cursorfixedheight: false,
+    directionlockdeadzone: 6,
+    hidecursordelay: 400,
+    nativeparentscrolling: true,
+    enablescrollonselection: true,
+    overflowx: true,
+    overflowy: true,
+    cursordragspeed: 0.3,
+    rtlmode: "auto",
+    cursordragontouch: false,
+    oneaxismousemode: "auto",
+    scriptpath: getScriptPath(),
+    preventmultitouchscrolling: true,
+    disablemutationobserver:false
+  };
+
+  var browserdetected = false;
+
+  var getBrowserDetection = function() {
+
+    if (browserdetected) return browserdetected;
+
+    var _el = document.createElement('DIV'),
+        _style = _el.style,
+        _agent = navigator.userAgent,
+        _platform = navigator.platform,
+        d = {};
+
+    d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
+
+    d.isopera = ("opera" in window); // 12-
+    d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
+    d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
+
+    d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
+    d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
+    d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
+    d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
+    d.isie9 = d.isie && ("performance" in window) && (document.documentMode == 9);
+    d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
+    d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
+    d.isieedge12 = (navigator.userAgent.match(/Edge\/12\./));  // IE Edge 12
+    d.isieedge = ("msOverflowStyle" in _el);  // IE Edge
+    d.ismodernie = d.isie11 || d.isieedge;
+
+    d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
+    if (d.isie9mobile) d.isie9 = false;
+    d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
+
+    d.ismozilla = ("MozAppearance" in _style);
+
+    d.iswebkit = ("WebkitAppearance" in _style);
+
+    d.ischrome = ("chrome" in window);
+    d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation
+    d.ischrome22 = (!d.ischrome38)&&(d.ischrome && d.haspointerlock);
+    d.ischrome26 = (!d.ischrome38)&&(d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
+
+    d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // with detection for Chrome Touch Emulation
+    d.hasw3ctouch = (window.PointerEvent || false) && ((navigator.MaxTouchPoints > 0)||(navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
+    d.hasmstouch = (!d.hasw3ctouch)&&(window.MSPointerEvent || false); // IE10 pointer events
+
+    d.ismac = /^mac$/i.test(_platform);
+
+    d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
+    d.isios4 = ((d.isios) && !("seal" in Object));
+    d.isios7 = ((d.isios)&&("webkitHidden" in document));  //iOS 7+
+    d.isios8 = ((d.isios)&&("hidden" in document));  //iOS 8+
+
+    d.isandroid = (/android/i.test(_agent));
+
+    d.haseventlistener = ("addEventListener" in _el);
+
+    d.trstyle = false;
+    d.hastransform = false;
+    d.hastranslate3d = false;
+    d.transitionstyle = false;
+    d.hastransition = false;
+    d.transitionend = false;
+
+    var a;
+    var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
+    for (a = 0; a < check.length; a++) {
+      if (_style[check[a]] !== undefined) {
+        d.trstyle = check[a];
+        break;
+      }
+    }
+    d.hastransform = (!!d.trstyle);
+    if (d.hastransform) {
+      _style[d.trstyle] = "translate3d(1px,2px,3px)";
+      d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
+    }
+
+    d.transitionstyle = false;
+    d.prefixstyle = '';
+    d.transitionend = false;
+    check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
+    var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
+    var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
+    for (a = 0; a < check.length; a++) {
+      if (check[a] in _style) {
+        d.transitionstyle = check[a];
+        d.prefixstyle = prefix[a];
+        d.transitionend = evs[a];
+        break;
+      }
+    }
+    if (d.ischrome26) {  // always use prefix
+      d.prefixstyle = prefix[1];
+    }
+
+    d.hastransition = (d.transitionstyle);
+
+    function detectCursorGrab() {
+      var lst = ['grab','-webkit-grab', '-moz-grab'];
+      if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
+      for (var a = 0; a < lst.length; a++) {
+        var p = lst[a];
+        _style.cursor = p;
+        if (_style.cursor == p) return p;
+      }
+      return 'url(//patriciaportfolio.googlecode.com/files/openhand.cur),n-resize'; // thank you google for custom cursor!
+    }
+    d.cursorgrabvalue = detectCursorGrab();
+
+    d.hasmousecapture = ("setCapture" in _el);
+
+    d.hasMutationObserver = (ClsMutationObserver !== false);
+
+    _el = null; //memory released
+
+    browserdetected = d;
+
+    return d;
+  };
+
+  var NiceScrollClass = function(myopt, me) {
+
+    var self = this;
+
+    this.version = '3.6.8';
+    this.name = 'nicescroll';
+
+    this.me = me;
+
+    this.opt = {
+      doc: $("body"),
+      win: false
+    };
+
+    $.extend(this.opt, _globaloptions);  // clone opts
+
+    // Options for internal use
+    this.opt.snapbackspeed = 80;
+
+    if (myopt || false) {
+      for (var a in self.opt) {
+        if (myopt[a] !== undefined) self.opt[a] = myopt[a];
+      }
+    }
+
+    if (self.opt.disablemutationobserver) ClsMutationObserver = false;
+
+    this.doc = self.opt.doc;
+    this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
+    this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
+    this.haswrapper = (self.opt.win !== false);
+    this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
+    this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
+    this.body = $("body");
+    this.viewport = false;
+
+    this.isfixed = false;
+
+    this.iframe = false;
+    this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
+
+    this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
+
+    this.forcescreen = false; //force to use screen position on events
+
+    this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
+
+    // Events jump table
+    this.onmousedown = false;
+    this.onmouseup = false;
+    this.onmousemove = false;
+    this.onmousewheel = false;
+    this.onkeypress = false;
+    this.ongesturezoom = false;
+    this.onclick = false;
+
+    // Nicescroll custom events
+    this.onscrollstart = false;
+    this.onscrollend = false;
+    this.onscrollcancel = false;
+
+    this.onzoomin = false;
+    this.onzoomout = false;
+
+    // Let's start!
+    this.view = false;
+    this.page = false;
+
+    this.scroll = {
+      x: 0,
+      y: 0
+    };
+    this.scrollratio = {
+      x: 0,
+      y: 0
+    };
+    this.cursorheight = 20;
+    this.scrollvaluemax = 0;
+
+    // http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
+    // http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
+    if (this.opt.rtlmode == "auto") {
+      var target = this.win[0] == window ? this.body : this.win;
+      var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");
+
+      if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode == "") {
+        this.isrtlmode = (target.css("direction") == "rtl");
+        this.isvertical = false;
+      } else {
+        this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
+        this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
+      }
+    } else {
+      this.isrtlmode = (this.opt.rtlmode === true);
+      this.isvertical = false;
+    }
+    //    this.checkrtlmode = false;
+
+    this.scrollrunning = false;
+
+    this.scrollmom = false;
+
+    this.observer        = false;  // observer div changes
+    this.observerremover = false;  // observer on parent for remove detection
+    this.observerbody    = false;  // observer on body for position change
+
+    do {
+      this.id = "ascrail" + (ascrailcounter++);
+    } while (document.getElementById(this.id));
+
+    this.rail = false;
+    this.cursor = false;
+    this.cursorfreezed = false;
+    this.selectiondrag = false;
+
+    this.zoom = false;
+    this.zoomactive = false;
+
+    this.hasfocus = false;
+    this.hasmousefocus = false;
+
+    this.visibility = true;
+    this.railslocked = false;  // locked by resize
+    this.locked = false;  // prevent lost of locked status sets by user
+    this.hidden = false; // rails always hidden
+    this.cursoractive = true; // user can interact with cursors
+
+    this.wheelprevented = false; //prevent mousewheel event
+
+    this.overflowx = self.opt.overflowx;
+    this.overflowy = self.opt.overflowy;
+
+    this.nativescrollingarea = false;
+    this.checkarea = 0;
+
+    this.events = []; // event list for unbind
+
+    this.saved = {};  // style saved
+
+    this.delaylist = {};
+    this.synclist = {};
+
+    this.lastdeltax = 0;
+    this.lastdeltay = 0;
+
+    this.detected = getBrowserDetection();
+
+    var cap = $.extend({}, this.detected);
+
+    this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
+    this.ishwscroll = (this.canhwscroll && self.haswrapper);
+
+    if (!this.isrtlmode) {
+      this.hasreversehr = false;
+    } else if (this.isvertical) { // RTL mode with reverse horizontal axis
+      this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
+    } else {
+      this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
+    }
+
+    this.istouchcapable = false; // desktop devices with touch screen support
+
+    //## Check WebKit-based desktop with touch support
+    //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
+
+    if (!cap.cantouch && (cap.hasw3ctouch||cap.hasmstouch)) {  // desktop device with multiple input
+      this.istouchcapable = true;
+    } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
+      this.istouchcapable = true;
+//      cap.cantouch = false; // parse normal desktop events
+    }
+
+    //## disable MouseLock API on user request
+    if (!self.opt.enablemouselockapi) {
+      cap.hasmousecapture = false;
+      cap.haspointerlock = false;
+    }
+
+/* deprecated
+    this.delayed = function(name, fn, tm, lazy) {
+    };
+*/
+
+/*
+    this.debounced = function(name, fn, tm) {
+		if (!self) return;
+      var dd = self.delaylist[name];
+      self.delaylist[name] = fn;
+      if (!dd) {
+        self.debouncedelayed =  setTimeout(function() {
+					if (!self) return;
+          var fn = self.delaylist[name];
+          self.delaylist[name] = false;
+          fn.call(self);
+        }, tm);
+      }
+    };
+*/
+
+		this.debounced = function(name, fn, tm) {
+      if (!self) return;
+			var dd = self.delaylist[name]||false;
+			if (!dd) {
+				fn.call(self);
+				self.delaylist[name] = {
+					h: setAnimationFrame(function(){
+						self.delaylist[name].fn.call(self);
+					  self.delaylist[name] = false;
+					}, tm)
+				};
+			}
+			self.delaylist[name].fn = fn;
+		};
+
+    var _onsync = false;
+
+    this.synched = function(name, fn) {
+
+      function requestSync() {
+        if (_onsync) return;
+        setAnimationFrame(function() {
+          if (!self) return;
+          _onsync = false;
+          for (var nn in self.synclist) {
+            var fn = self.synclist[nn];
+            if (fn) fn.call(self);
+            self.synclist[nn] = false;
+          }
+        });
+        _onsync = true;
+      }
+
+      self.synclist[name] = fn;
+      requestSync();
+      return name;
+    };
+
+    this.unsynched = function(name) {
+      if (self.synclist[name]) self.synclist[name] = false;
+    };
+
+    this.css = function(el, pars) { // save & set
+      for (var n in pars) {
+        self.saved.css.push([el, n, el.css(n)]);
+        el.css(n, pars[n]);
+      }
+    };
+
+    this.scrollTop = function(val) {
+      return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
+    };
+
+    this.scrollLeft = function(val) {
+      return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
+    };
+
+    // derived by by Dan Pupius www.pupius.net
+    var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
+
+      this.st = st;
+      this.ed = ed;
+      this.spd = spd;
+
+      this.p1 = p1 || 0;
+      this.p2 = p2 || 1;
+      this.p3 = p3 || 0;
+      this.p4 = p4 || 1;
+
+      this.ts = (new Date()).getTime();
+      this.df = this.ed - this.st;
+    };
+    BezierClass.prototype = {
+      B2: function(t) {
+        return 3 * t * t * (1 - t);
+      },
+      B3: function(t) {
+        return 3 * t * (1 - t) * (1 - t);
+      },
+      B4: function(t) {
+        return (1 - t) * (1 - t) * (1 - t);
+      },
+      getNow: function() {
+        var nw = (new Date()).getTime();
+        var pc = 1 - ((nw - this.ts) / this.spd);
+        var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
+        return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
+      },
+      update: function(ed, spd) {
+        this.st = this.getNow();
+        this.ed = ed;
+        this.spd = spd;
+        this.ts = (new Date()).getTime();
+        this.df = this.ed - this.st;
+        return this;
+      }
+    };
+
+    //derived from http://stackoverflow.com/questions/11236090/
+    function getMatrixValues() {
+      var tr = self.doc.css(cap.trstyle);
+      if (tr && (tr.substr(0, 6) == "matrix")) {
+        return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
+      }
+      return false;
+    }
+
+    if (this.ishwscroll) {
+      // hw accelerated scroll
+      this.doc.translate = {
+        x: 0,
+        y: 0,
+        tx: "0px",
+        ty: "0px"
+      };
+
+      //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
+      if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
+
+      this.getScrollTop = function(last) {
+        if (!last) {
+          var mtx = getMatrixValues();
+          if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
+          if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
+        }
+        return self.doc.translate.y;
+      };
+
+      this.getScrollLeft = function(last) {
+        if (!last) {
+          var mtx = getMatrixValues();
+          if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
+          if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
+        }
+        return self.doc.translate.x;
+      };
+
+      this.notifyScrollEvent = function(el) {
+        var e = document.createEvent("UIEvents");
+        e.initUIEvent("scroll", false, true, window, 1);
+        e.niceevent = true;
+        el.dispatchEvent(e);
+      };
+
+      var cxscrollleft = (this.isrtlmode) ? 1 : -1;
+
+      if (cap.hastranslate3d && self.opt.enabletranslate3d) {
+        this.setScrollTop = function(val, silent) {
+          self.doc.translate.y = val;
+          self.doc.translate.ty = (val * -1) + "px";
+          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+        this.setScrollLeft = function(val, silent) {
+          self.doc.translate.x = val;
+          self.doc.translate.tx = (val * cxscrollleft) + "px";
+          self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+      } else {
+        this.setScrollTop = function(val, silent) {
+          self.doc.translate.y = val;
+          self.doc.translate.ty = (val * -1) + "px";
+          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+        this.setScrollLeft = function(val, silent) {
+          self.doc.translate.x = val;
+          self.doc.translate.tx = (val * cxscrollleft) + "px";
+          self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
+          if (!silent) self.notifyScrollEvent(self.win[0]);
+        };
+      }
+    } else {
+      // native scroll
+      this.getScrollTop = function() {
+        return self.docscroll.scrollTop();
+      };
+      this.setScrollTop = function(val) {
+        return setTimeout(function() {(self)&&self.docscroll.scrollTop(val)}, 1);
+      };
+      this.getScrollLeft = function() {
+        var val;
+        if (!self.hasreversehr) {
+          val = self.docscroll.scrollLeft();
+        } else if (self.detected.ismozilla) {
+          val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
+        } else {
+          val = self.page.maxw - self.docscroll.scrollLeft();
+        }
+        return val;
+      };
+      this.setScrollLeft = function(val) {
+        return setTimeout(function() {
+          if (!self) return;
+					if (self.hasreversehr) {
+						if (self.detected.ismozilla) {
+							val = -(self.page.maxw - val);
+						} else {
+							val = self.page.maxw - val;
+						}
+					}
+					return self.docscroll.scrollLeft(val);
+				}, 1);
+      };
+    }
+
+    this.getTarget = function(e) {
+      if (!e) return false;
+      if (e.target) return e.target;
+      if (e.srcElement) return e.srcElement;
+      return false;
+    };
+
+    this.hasParent = function(e, id) {
+      if (!e) return false;
+      var el = e.target || e.srcElement || e || false;
+      while (el && el.id != id) {
+        el = el.parentNode || false;
+      }
+      return (el !== false);
+    };
+
+    function getZIndex() {
+      var dom = self.win;
+      if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
+      while (dom.length > 0) {
+        if (dom[0].nodeType == 9) return false;
+        var zi = dom.css('zIndex');
+        if (!isNaN(zi) && zi != 0) return parseInt(zi);
+        dom = dom.parent();
+      }
+      return false;
+    }
+
+    //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
+    var _convertBorderWidth = {
+      "thin": 1,
+      "medium": 3,
+      "thick": 5
+    };
+
+    function getWidthToPixel(dom, prop, chkheight) {
+      var wd = dom.css(prop);
+      var px = parseFloat(wd);
+      if (isNaN(px)) {
+        px = _convertBorderWidth[wd] || 0;
+        var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
+        if (self.isie8 && px) px += 1;
+        return (brd) ? px : 0;
+      }
+      return px;
+    }
+
+    this.getDocumentScrollOffset = function() {
+      return {
+        top: window.pageYOffset || document.documentElement.scrollTop,
+        left: window.pageXOffset || document.documentElement.scrollLeft
+      };
+    };
+
+    this.getOffset = function() {
+      if (self.isfixed) {
+        var ofs = self.win.offset();  // fix Chrome auto issue (when right/bottom props only)
+        var scrl = self.getDocumentScrollOffset();
+        ofs.top-=scrl.top;
+        ofs.left-=scrl.left;
+        return ofs;
+      }
+      var ww = self.win.offset();
+      if (!self.viewport) return ww;
+      var vp = self.viewport.offset();
+      return {
+        top: ww.top - vp.top,// + self.viewport.scrollTop(),
+        left: ww.left - vp.left // + self.viewport.scrollLeft()
+      };
+    };
+
+    this.updateScrollBar = function(len) {
+      var pos, off;
+      if (self.ishwscroll) {
+        self.rail.css({  //**
+          height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+        });
+        if (self.railh) self.railh.css({  //**
+          width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
+        });
+
+      } else {
+        var wpos = self.getOffset();
+        pos = {
+          top: wpos.top,
+          left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
+        };
+        pos.top += getWidthToPixel(self.win, 'border-top-width', true);
+        pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
+
+        off = self.opt.railoffset;
+        if (off) {
+          if (off.top) pos.top += off.top;
+          if (off.left) pos.left += off.left;
+        }
+
+        if (!self.railslocked) self.rail.css({
+          top: pos.top,
+          left: pos.left,
+          height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
+        });
+
+        if (self.zoom) {
+          self.zoom.css({
+            top: pos.top + 1,
+            left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
+          });
+        }
+
+        if (self.railh && !self.railslocked) {
+          pos = {
+            top: wpos.top,
+            left: wpos.left
+          };
+          off = self.opt.railhoffset;
+          if (off) {
+            if (off.top) pos.top += off.top;
+            if (off.left) pos.left += off.left;
+          }
+          var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
+          var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
+          self.railh.css({
+            top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
+            left: x,
+            width: self.railh.width
+          });
+        }
+
+      }
+    };
+
+    this.doRailClick = function(e, dbl, hr) {
+      var fn, pg, cur, pos;
+
+      if (self.railslocked) return;
+      self.cancelEvent(e);
+
+      if (dbl) {
+        fn = (hr) ? self.doScrollLeft : self.doScrollTop;
+        cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
+        fn(cur);
+      } else {
+        fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
+        cur = (hr) ? self.scroll.x : self.scroll.y;
+        pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
+        pg = (hr) ? self.view.w : self.view.h;
+        fn((cur >= pos) ? pg: -pg);//   (cur >= pos) ? fn(pg): fn(-pg);
+      }
+
+    };
+
+    self.hasanimationframe = (setAnimationFrame);
+    self.hascancelanimationframe = (clearAnimationFrame);
+
+    if (!self.hasanimationframe) {
+      setAnimationFrame = function(fn) {
+        return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
+      }; // 1000/60)};
+      clearAnimationFrame = clearTimeout;
+    } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
+      self.cancelAnimationFrame = true;
+    };
+
+    this.init = function() {
+
+      self.saved.css = [];
+
+      if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
+      if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
+
+      var _touchaction = (cap.isie10) ? '-ms-touch-action' : 'touch-action';
+      if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
+        _touchaction: 'none'
+      });
+
+      var _scrollyhidden =  (cap.ismodernie||cap.isie10) ? {'-ms-overflow-style':'none'} : {'overflow-y':'hidden'};  // IE is always a world apart!
+
+      self.zindex = "auto";
+      if (!self.ispage && self.opt.zindex == "auto") {
+        self.zindex = getZIndex() || "auto";
+      } else {
+        self.zindex = self.opt.zindex;
+      }
+
+      if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
+        globalmaxzindex = self.zindex;
+      }
+
+      if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
+        self.zindex = "auto";
+      }
+
+      if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
+
+        var cont = self.docscroll;
+        if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
+
+        if (!cap.isie9mobile) self.css(cont, _scrollyhidden);
+
+        if (self.ispage && cap.isie7) {
+          if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
+            'overflow-y': 'hidden'
+          }); //IE7 double scrollbar issue
+          else if (self.doc[0].nodeName == 'HTML') self.css($("body"), _scrollyhidden); //IE7 double scrollbar issue
+        }
+
+        if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
+          "-webkit-overflow-scrolling": "touch"
+        }); //force hw acceleration
+
+        var cursor = $(document.createElement('div'));
+        cursor.css({
+          position: "relative",
+          top: 0,
+          "float": "right",
+          width: self.opt.cursorwidth,
+          height: 0,
+          'background-color': self.opt.cursorcolor,
+          border: self.opt.cursorborder,
+          'background-clip': 'padding-box',
+          '-webkit-border-radius': self.opt.cursorborderradius,
+          '-moz-border-radius': self.opt.cursorborderradius,
+          'border-radius': self.opt.cursorborderradius
+        });
+
+        cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
+
+        cursor.addClass('nicescroll-cursors');
+
+        self.cursor = cursor;
+
+        var rail = $(document.createElement('div'));
+        rail.attr('id', self.id);
+        rail.addClass('nicescroll-rails nicescroll-rails-vr');
+
+        var v, a, kp = ["left","right","top","bottom"];  //**
+        for (var n in kp) {
+          a = kp[n];
+          v = self.opt.railpadding[a];
+          (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
+        }
+
+        rail.append(cursor);
+
+        rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
+        rail.css({
+          width: rail.width + "px",
+          zIndex: self.zindex,
+          background: self.opt.background,
+          cursor: "default"
+        });
+
+        rail.visibility = true;
+        rail.scrollable = true;
+
+        rail.align = (self.opt.railalign == "left") ? 0 : 1;
+
+        self.rail = rail;
+
+        self.rail.drag = false;
+
+        var zoom = false;
+        if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
+          zoom = document.createElement('div');
+
+          self.bind(zoom, "click", self.doZoom);
+          self.bind(zoom, "mouseenter", function() {
+            self.zoom.css('opacity', self.opt.cursoropacitymax);
+          });
+          self.bind(zoom, "mouseleave", function() {
+            self.zoom.css('opacity', self.opt.cursoropacitymin);
+          });
+
+          self.zoom = $(zoom);
+          self.zoom.css({
+            cursor: "pointer",
+            zIndex: self.zindex,
+            backgroundImage: 'url(' + self.opt.scriptpath + 'zoomico.png)',
+            height: 18,
+            width: 18,
+            backgroundPosition: '0px 0px'
+          });
+          if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
+          if (cap.cantouch && self.opt.gesturezoom) {
+            self.ongesturezoom = function(e) {
+              if (e.scale > 1.5) self.doZoomIn(e);
+              if (e.scale < 0.8) self.doZoomOut(e);
+              return self.cancelEvent(e);
+            };
+            self.bind(self.win, "gestureend", self.ongesturezoom);
+          }
+        }
+
+        // init HORIZ
+
+        self.railh = false;
+        var railh;
+
+        if (self.opt.horizrailenabled) {
+
+          self.css(cont, {
+            overflowX: 'hidden'
+          });
+
+          var cursor = $(document.createElement('div'));
+          cursor.css({
+            position: "absolute",
+            top: 0,
+            height: self.opt.cursorwidth,
+            width: 0,
+            backgroundColor: self.opt.cursorcolor,
+            border: self.opt.cursorborder,
+            backgroundClip: 'padding-box',
+            '-webkit-border-radius': self.opt.cursorborderradius,
+            '-moz-border-radius': self.opt.cursorborderradius,
+            'border-radius': self.opt.cursorborderradius
+          });
+
+          if (cap.isieold) cursor.css('overflow', 'hidden');  //IE6 horiz scrollbar issue
+
+          cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
+
+          cursor.addClass('nicescroll-cursors');
+
+          self.cursorh = cursor;
+
+          railh = $(document.createElement('div'));
+          railh.attr('id', self.id + '-hr');
+          railh.addClass('nicescroll-rails nicescroll-rails-hr');
+          railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
+          railh.css({
+            height: railh.height + "px",
+            'zIndex': self.zindex,
+            "background": self.opt.background
+          });
+
+          railh.append(cursor);
+
+          railh.visibility = true;
+          railh.scrollable = true;
+
+          railh.align = (self.opt.railvalign == "top") ? 0 : 1;
+
+          self.railh = railh;
+
+          self.railh.drag = false;
+
+        }
+
+        //
+
+        if (self.ispage) {
+          rail.css({
+            position: "fixed",
+            top: 0,
+            height: "100%"
+          });
+          (rail.align) ? rail.css({
+            right: 0
+          }): rail.css({
+            left: 0
+          });
+          self.body.append(rail);
+          if (self.railh) {
+            railh.css({
+              position: "fixed",
+              left: 0,
+              width: "100%"
+            });
+            (railh.align) ? railh.css({
+              bottom: 0
+            }): railh.css({
+              top: 0
+            });
+            self.body.append(railh);
+          }
+        } else {
+          if (self.ishwscroll) {
+            if (self.win.css('position') == 'static') self.css(self.win, {
+              'position': 'relative'
+            });
+            var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
+            $(bd).scrollTop(0).scrollLeft(0);  // fix rail position if content already scrolled
+            if (self.zoom) {
+              self.zoom.css({
+                position: "absolute",
+                top: 1,
+                right: 0,
+                "margin-right": rail.width + 4
+              });
+              bd.append(self.zoom);
+            }
+            rail.css({
+              position: "absolute",
+              top: 0
+            });
+            (rail.align) ? rail.css({
+              right: 0
+            }): rail.css({
+              left: 0
+            });
+            bd.append(rail);
+            if (railh) {
+              railh.css({
+                position: "absolute",
+                left: 0,
+                bottom: 0
+              });
+              (railh.align) ? railh.css({
+                bottom: 0
+              }): railh.css({
+                top: 0
+              });
+              bd.append(railh);
+            }
+          } else {
+            self.isfixed = (self.win.css("position") == "fixed");
+            var rlpos = (self.isfixed) ? "fixed" : "absolute";
+
+            if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
+            if (self.viewport) {
+              self.body = self.viewport;
+              if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
+                "position": "relative"
+              });
+            }
+
+            rail.css({
+              position: rlpos
+            });
+            if (self.zoom) self.zoom.css({
+              position: rlpos
+            });
+            self.updateScrollBar();
+            self.body.append(rail);
+            if (self.zoom) self.body.append(self.zoom);
+            if (self.railh) {
+              railh.css({
+                position: rlpos
+              });
+              self.body.append(railh);
+            }
+          }
+
+          if (cap.isios) self.css(self.win, {
+            '-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
+            '-webkit-touch-callout': 'none'
+          }); // prevent grey layer on click
+
+          if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
+          if (cap.iswebkit && self.opt.disableoutline) self.win.css('outline', 'none');  // Webkit outline
+          //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"});  // Opera 12- to test [TODO]
+
+        }
+
+        if (self.opt.autohidemode === false) {
+          self.autohidedom = false;
+          self.rail.css({
+            opacity: self.opt.cursoropacitymax
+          });
+          if (self.railh) self.railh.css({
+            opacity: self.opt.cursoropacitymax
+          });
+        } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
+          self.autohidedom = $().add(self.rail);
+          if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
+          if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
+        } else if (self.opt.autohidemode == "scroll") {
+          self.autohidedom = $().add(self.rail);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
+        } else if (self.opt.autohidemode == "cursor") {
+          self.autohidedom = $().add(self.cursor);
+          if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
+        } else if (self.opt.autohidemode == "hidden") {
+          self.autohidedom = false;
+          self.hide();
+          self.railslocked = false;
+        }
+
+        if (cap.isie9mobile) {
+
+          self.scrollmom = new ScrollMomentumClass2D(self);
+
+          self.onmangotouch = function() {
+            var py = self.getScrollTop();
+            var px = self.getScrollLeft();
+
+            if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
+
+            var dfy = py - self.mangotouch.sy;
+            var dfx = px - self.mangotouch.sx;
+            var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
+            if (df == 0) return;
+
+            var dry = (dfy < 0) ? -1 : 1;
+            var drx = (dfx < 0) ? -1 : 1;
+
+            var tm = +new Date();
+            if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
+
+            if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
+              self.scrollmom.stop();
+              self.scrollmom.reset(px, py);
+              self.mangotouch.sy = py;
+              self.mangotouch.ly = py;
+              self.mangotouch.sx = px;
+              self.mangotouch.lx = px;
+              self.mangotouch.dry = dry;
+              self.mangotouch.drx = drx;
+              self.mangotouch.tm = tm;
+            } else {
+
+              self.scrollmom.stop();
+              self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
+              self.mangotouch.tm = tm;
+
+              var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
+              self.mangotouch.ly = py;
+              self.mangotouch.lx = px;
+
+              if (ds > 2) {
+                self.mangotouch.lazy = setTimeout(function() {
+                  self.mangotouch.lazy = false;
+                  self.mangotouch.dry = 0;
+                  self.mangotouch.drx = 0;
+                  self.mangotouch.tm = 0;
+                  self.scrollmom.doMomentum(30);
+                }, 100);
+              }
+            }
+          };
+
+          var top = self.getScrollTop();
+          var lef = self.getScrollLeft();
+          self.mangotouch = {
+            sy: top,
+            ly: top,
+            dry: 0,
+            sx: lef,
+            lx: lef,
+            drx: 0,
+            lazy: false,
+            tm: 0
+          };
+
+          self.bind(self.docscroll, "scroll", self.onmangotouch);
+
+        } else {
+
+          if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
+
+            self.scrollmom = new ScrollMomentumClass2D(self);
+
+            self.ontouchstart = function(e) {
+              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+
+              self.hasmoving = false;
+
+              if (!self.railslocked) {
+                var tg;
+                if (cap.hasmstouch) {
+                  tg = (e.target) ? e.target : false;
+                  while (tg) {
+                    var nc = $(tg).getNiceScroll();
+                    if ((nc.length > 0) && (nc[0].me == self.me)) break;
+                    if (nc.length > 0) return false;
+                    if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
+                    tg = (tg.parentNode) ? tg.parentNode : false;
+                  }
+                }
+
+                self.cancelScroll();
+
+                tg = self.getTarget(e);
+
+                if (tg) {
+                  var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
+                  if (skp) return self.stopPropagation(e);
+                }
+
+                if (!("clientX" in e) && ("changedTouches" in e)) {
+                  e.clientX = e.changedTouches[0].clientX;
+                  e.clientY = e.changedTouches[0].clientY;
+                }
+
+                if (self.forcescreen) {
+                  var le = e;
+                  e = {
+                    "original": (e.original) ? e.original : e
+                  };
+                  e.clientX = le.screenX;
+                  e.clientY = le.screenY;
+                }
+
+                self.rail.drag = {
+                  x: e.clientX,
+                  y: e.clientY,
+                  sx: self.scroll.x,
+                  sy: self.scroll.y,
+                  st: self.getScrollTop(),
+                  sl: self.getScrollLeft(),
+                  pt: 2,
+                  dl: false
+                };
+
+                if (self.ispage || !self.opt.directionlockdeadzone) {
+                  self.rail.drag.dl = "f";
+                } else {
+
+                  var view = {
+                    w: $(window).width(),
+                    h: $(window).height()
+                  };
+
+                  var page = {
+                    w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
+                    h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
+                  };
+
+                  var maxh = Math.max(0, page.h - view.h);
+                  var maxw = Math.max(0, page.w - view.w);
+
+                  if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
+                  else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
+                  else self.rail.drag.ck = false;
+                  if (!self.rail.drag.ck) self.rail.drag.dl = "f";
+                }
+
+                if (self.opt.touchbehavior && self.isiframe && cap.isie) {
+                  var wp = self.win.position();
+                  self.rail.drag.x += wp.left;
+                  self.rail.drag.y += wp.top;
+                }
+
+                self.hasmoving = false;
+                self.lastmouseup = false;
+                self.scrollmom.reset(e.clientX, e.clientY);
+
+                if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {
+
+                  var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
+                  if (!ip) {
+                    if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+                    if (self.opt.touchbehavior) {
+                      if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
+                        tg._onclick = tg.onclick;
+                        tg.onclick = function(e) {
+                          if (self.hasmoving) return false;
+                          tg._onclick.call(this, e);
+                        };
+                      }
+                      return self.cancelEvent(e);
+                    }
+                    return self.stopPropagation(e);
+                  }
+
+                  if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
+                    pc = {
+                      "tg": tg,
+                      "click": false
+                    };
+                    self.preventclick = pc;
+                  }
+
+                }
+              }
+
+            };
+
+            self.ontouchend = function(e) {
+              if (!self.rail.drag) return true;
+              if (self.rail.drag.pt == 2) {
+                if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+
+                self.scrollmom.doMomentum();
+                self.rail.drag = false;
+                if (self.hasmoving) {
+                  self.lastmouseup = true;
+                  self.hideCursor();
+                  if (cap.hasmousecapture) document.releaseCapture();
+                  if (!cap.cantouch) return self.cancelEvent(e);
+                }
+              }
+              else if (self.rail.drag.pt == 1) {
+                return self.onmouseup(e);
+              }
+
+            };
+
+            var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
+
+            self.ontouchmove = function(e, byiframe) {
+
+              if (!self.rail.drag) return false;
+
+              if (e.targetTouches && self.opt.preventmultitouchscrolling) {
+                if (e.targetTouches.length > 1) return false; // multitouch
+              }
+
+              if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
+
+              if (self.rail.drag.pt == 2) {
+                if (cap.cantouch && (cap.isios) && e.original === undefined) return true; // prevent ios "ghost" events by clickable elements
+
+                self.hasmoving = true;
+
+                if (self.preventclick && !self.preventclick.click) {
+                  self.preventclick.click = self.preventclick.tg.onclick || false;
+                  self.preventclick.tg.onclick = self.onpreventclick;
+                }
+
+                var ev = $.extend({
+                  "original": e
+                }, e);
+                e = ev;
+
+                if (("changedTouches" in e)) {
+                  e.clientX = e.changedTouches[0].clientX;
+                  e.clientY = e.changedTouches[0].clientY;
+                }
+
+                if (self.forcescreen) {
+                  var le = e;
+                  e = {
+                    "original": (e.original) ? e.original : e
+                  };
+                  e.clientX = le.screenX;
+                  e.clientY = le.screenY;
+                }
+
+                var ofy,ofx;
+                ofx = ofy = 0;
+
+                if (moveneedoffset && !byiframe) {
+                  var wp = self.win.position();
+                  ofx = -wp.left;
+                  ofy = -wp.top;
+                }
+
+                var fy = e.clientY + ofy;
+                var my = (fy - self.rail.drag.y);
+                var fx = e.clientX + ofx;
+                var mx = (fx - self.rail.drag.x);
+
+                var ny = self.rail.drag.st - my;
+
+                if (self.ishwscroll && self.opt.bouncescroll) {
+                  if (ny < 0) {
+                    ny = Math.round(ny / 2);
+                    //                    fy = 0;
+                  } else if (ny > self.page.maxh) {
+                    ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
+                    //                    fy = 0;
+                  }
+                } else {
+                  if (ny < 0) {
+                    ny = 0;
+                    fy = 0;
+                  }
+                  if (ny > self.page.maxh) {
+                    ny = self.page.maxh;
+                    fy = 0;
+                  }
+                }
+
+                var nx;
+                if (self.railh && self.railh.scrollable) {
+                  nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
+
+                  if (self.ishwscroll && self.opt.bouncescroll) {
+                    if (nx < 0) {
+                      nx = Math.round(nx / 2);
+                      //                      fx = 0;
+                    } else if (nx > self.page.maxw) {
+                      nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
+                      //                      fx = 0;
+                    }
+                  } else {
+                    if (nx < 0) {
+                      nx = 0;
+                      fx = 0;
+                    }
+                    if (nx > self.page.maxw) {
+                      nx = self.page.maxw;
+                      fx = 0;
+                    }
+                  }
+
+                }
+
+                var grabbed = false;
+                if (self.rail.drag.dl) {
+                  grabbed = true;
+                  if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
+                  else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
+                } else {
+                  var ay = Math.abs(my);
+                  var ax = Math.abs(mx);
+                  var dz = self.opt.directionlockdeadzone;
+                  if (self.rail.drag.ck == "v") {
+                    if (ay > dz && (ax <= (ay * 0.3))) {
+                      self.rail.drag = false;
+                      return true;
+                    } else if (ax > dz) {
+                      self.rail.drag.dl = "f";
+                      $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
+                    }
+                  } else if (self.rail.drag.ck == "h") {
+                    if (ax > dz && (ay <= (ax * 0.3))) {
+                      self.rail.drag = false;
+                      return true;
+                    } else if (ay > dz) {
+                      self.rail.drag.dl = "f";
+                      $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
+                    }
+                  }
+                }
+
+                self.synched("touchmove", function() {
+                  if (self.rail.drag && (self.rail.drag.pt == 2)) {
+                    if (self.prepareTransition) self.prepareTransition(0);
+                    if (self.rail.scrollable) self.setScrollTop(ny);
+                    self.scrollmom.update(fx, fy);
+                    if (self.railh && self.railh.scrollable) {
+                      self.setScrollLeft(nx);
+                      self.showCursor(ny, nx);
+                    } else {
+                      self.showCursor(ny);
+                    }
+                    if (cap.isie10) document.selection.clear();
+                  }
+                });
+
+                if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
+                if (grabbed) return self.cancelEvent(e);
+              }
+              else if (self.rail.drag.pt == 1) { // drag on cursor
+                return self.onmousemove(e);
+              }
+
+            };
+
+          }
+
+          self.onmousedown = function(e, hronly) {
+            if (self.rail.drag && self.rail.drag.pt != 1) return;
+            if (self.railslocked) return self.cancelEvent(e);
+            self.cancelScroll();
+            self.rail.drag = {
+              x: e.clientX,
+              y: e.clientY,
+              sx: self.scroll.x,
+              sy: self.scroll.y,
+              pt: 1,
+              hr: (!!hronly)
+            };
+            var tg = self.getTarget(e);
+            if (!self.ispage && cap.hasmousecapture) tg.setCapture();
+            if (self.isiframe && !cap.hasmousecapture) {
+              self.saved.csspointerevents = self.doc.css("pointer-events");
+              self.css(self.doc, {
+                "pointer-events": "none"
+              });
+            }
+            self.hasmoving = false;
+            return self.cancelEvent(e);
+          };
+
+          self.onmouseup = function(e) {
+            if (self.rail.drag) {
+              if (self.rail.drag.pt != 1) return true;
+
+              if (cap.hasmousecapture) document.releaseCapture();
+              if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
+              self.rail.drag = false;
+              //if (!self.rail.active) self.hideCursor();
+              if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
+              return self.cancelEvent(e);
+            }
+          };
+
+          self.onmousemove = function(e) {
+            if (self.rail.drag) {
+              if (self.rail.drag.pt != 1) return;
+
+              if (cap.ischrome && e.which == 0) return self.onmouseup(e);
+
+              self.cursorfreezed = true;
+              self.hasmoving = true;
+
+              if (self.rail.drag.hr) {
+                self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
+                if (self.scroll.x < 0) self.scroll.x = 0;
+                var mw = self.scrollvaluemaxw;
+                if (self.scroll.x > mw) self.scroll.x = mw;
+              } else {
+                self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
+                if (self.scroll.y < 0) self.scroll.y = 0;
+                var my = self.scrollvaluemax;
+                if (self.scroll.y > my) self.scroll.y = my;
+              }
+
+              self.synched('mousemove', function() {
+                if (self.rail.drag && (self.rail.drag.pt == 1)) {
+                  self.showCursor();
+                  if (self.rail.drag.hr) {
+                    if (self.hasreversehr) {
+                      self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    } else {
+                      self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
+                    }
+                  }
+                  else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
+                }
+              });
+
+              return self.cancelEvent(e);
+            }
+            else {
+              self.checkarea = 0;
+            }
+          };
+
+          if (cap.cantouch || self.opt.touchbehavior) {
+
+            self.onpreventclick = function(e) {
+              if (self.preventclick) {
+                self.preventclick.tg.onclick = self.preventclick.click;
+                self.preventclick = false;
+                return self.cancelEvent(e);
+              }
+            };
+
+            self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
+
+            self.onclick = (cap.isios) ? false : function(e) {  // it needs to check IE11 ???
+              if (self.lastmouseup) {
+                self.lastmouseup = false;
+                return self.cancelEvent(e);
+              } else {
+                return true;
+              }
+            };
+
+            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
+              self.css((self.ispage) ? self.doc : self.win, {
+                'cursor': cap.cursorgrabvalue
+              });
+              self.css(self.rail, {
+                'cursor': cap.cursorgrabvalue
+              });
+            }
+
+          } else {
+
+            var checkSelectionScroll = function(e) {
+              if (!self.selectiondrag) return;
+
+              if (e) {
+                var ww = self.win.outerHeight();
+                var df = (e.pageY - self.selectiondrag.top);
+                if (df > 0 && df < ww) df = 0;
+                if (df >= ww) df -= ww;
+                self.selectiondrag.df = df;
+              }
+              if (self.selectiondrag.df == 0) return;
+
+              var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
+              self.doScrollBy(rt);
+
+              self.debounced("doselectionscroll", function() {
+                checkSelectionScroll();
+              }, 50);
+            };
+
+            if ("getSelection" in document) { // A grade - Major browsers
+              self.hasTextSelected = function() {
+                return (document.getSelection().rangeCount > 0);
+              };
+            } else if ("selection" in document) { //IE9-
+              self.hasTextSelected = function() {
+                return (document.selection.type != "None");
+              };
+            } else {
+              self.hasTextSelected = function() { // no support
+                return false;
+              };
+            }
+
+            self.onselectionstart = function(e) {
+/*  More testing - severe chrome issues
+              if (!self.haswrapper&&(e.which&&e.which==2)) {  // fool browser to manage middle button scrolling
+                self.win.css({'overflow':'auto'});
+                setTimeout(function(){
+                  self.win.css({'overflow':''});
+                },10);
+                return true;
+              }
+*/
+              if (self.ispage) return;
+              self.selectiondrag = self.win.offset();
+            };
+
+            self.onselectionend = function(e) {
+              self.selectiondrag = false;
+            };
+            self.onselectiondrag = function(e) {
+              if (!self.selectiondrag) return;
+              if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
+                checkSelectionScroll(e);
+              }, 250);
+            };
+
+
+          }
+
+          if (cap.hasw3ctouch) { //IE11+
+            self.css(self.rail, {
+              'touch-action': 'none'
+            });
+            self.css(self.cursor, {
+              'touch-action': 'none'
+            });
+            self.bind(self.win, "pointerdown", self.ontouchstart);
+            self.bind(document, "pointerup", self.ontouchend);
+            self.bind(document, "pointermove", self.ontouchmove);
+          } else if (cap.hasmstouch) { //IE10
+            self.css(self.rail, {
+              '-ms-touch-action': 'none'
+            });
+            self.css(self.cursor, {
+              '-ms-touch-action': 'none'
+            });
+            self.bind(self.win, "MSPointerDown", self.ontouchstart);
+            self.bind(document, "MSPointerUp", self.ontouchend);
+            self.bind(document, "MSPointerMove", self.ontouchmove);
+            self.bind(self.cursor, "MSGestureHold", function(e) {
+              e.preventDefault();
+            });
+            self.bind(self.cursor, "contextmenu", function(e) {
+              e.preventDefault();
+            });
+          } else if (this.istouchcapable) { //desktop with screen touch enabled
+            self.bind(self.win, "touchstart", self.ontouchstart);
+            self.bind(document, "touchend", self.ontouchend);
+            self.bind(document, "touchcancel", self.ontouchend);
+            self.bind(document, "touchmove", self.ontouchmove);
+          }
+
+
+          if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
+
+            self.rail.css({
+              cursor: "default"
+            });
+            self.railh && self.railh.css({
+              cursor: "default"
+            });
+
+            self.jqbind(self.rail, "mouseenter", function() {
+              if (!self.ispage && !self.win.is(":visible")) return false;
+              if (self.canshowonmouseevent) self.showCursor();
+              self.rail.active = true;
+            });
+            self.jqbind(self.rail, "mouseleave", function() {
+              self.rail.active = false;
+              if (!self.rail.drag) self.hideCursor();
+            });
+
+            if (self.opt.sensitiverail) {
+              self.bind(self.rail, "click", function(e) {
+                self.doRailClick(e, false, false);
+              });
+              self.bind(self.rail, "dblclick", function(e) {
+                self.doRailClick(e, true, false);
+              });
+              self.bind(self.cursor, "click", function(e) {
+                self.cancelEvent(e);
+              });
+              self.bind(self.cursor, "dblclick", function(e) {
+                self.cancelEvent(e);
+              });
+            }
+
+            if (self.railh) {
+              self.jqbind(self.railh, "mouseenter", function() {
+                if (!self.ispage && !self.win.is(":visible")) return false;
+                if (self.canshowonmouseevent) self.showCursor();
+                self.rail.active = true;
+              });
+              self.jqbind(self.railh, "mouseleave", function() {
+                self.rail.active = false;
+                if (!self.rail.drag) self.hideCursor();
+              });
+
+              if (self.opt.sensitiverail) {
+                self.bind(self.railh, "click", function(e) {
+                  self.doRailClick(e, false, true);
+                });
+                self.bind(self.railh, "dblclick", function(e) {
+                  self.doRailClick(e, true, true);
+                });
+                self.bind(self.cursorh, "click", function(e) {
+                  self.cancelEvent(e);
+                });
+                self.bind(self.cursorh, "dblclick", function(e) {
+                  self.cancelEvent(e);
+                });
+              }
+
+            }
+
+          }
+
+          if (!cap.cantouch && !self.opt.touchbehavior) {
+
+            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
+            self.bind(document, "mousemove", self.onmousemove);
+            if (self.onclick) self.bind(document, "click", self.onclick);
+
+            self.bind(self.cursor, "mousedown", self.onmousedown);
+            self.bind(self.cursor, "mouseup", self.onmouseup);
+
+            if (self.railh) {
+              self.bind(self.cursorh, "mousedown", function(e) {
+                self.onmousedown(e, true);
+              });
+              self.bind(self.cursorh, "mouseup", self.onmouseup);
+            }
+
+            if (!self.ispage && self.opt.enablescrollonselection) {
+              self.bind(self.win[0], "mousedown", self.onselectionstart);
+              self.bind(document, "mouseup", self.onselectionend);
+              self.bind(self.cursor, "mouseup", self.onselectionend);
+              if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
+              self.bind(document, "mousemove", self.onselectiondrag);
+            }
+
+            if (self.zoom) {
+              self.jqbind(self.zoom, "mouseenter", function() {
+                if (self.canshowonmouseevent) self.showCursor();
+                self.rail.active = true;
+              });
+              self.jqbind(self.zoom, "mouseleave", function() {
+                self.rail.active = false;
+                if (!self.rail.drag) self.hideCursor();
+              });
+            }
+
+          } else {
+
+            self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
+            self.bind(document, "mousemove", self.ontouchmove);
+            if (self.onclick) self.bind(document, "click", self.onclick);
+
+            if (self.opt.cursordragontouch) {
+              self.bind(self.cursor, "mousedown", self.onmousedown);
+              self.bind(self.cursor, "mouseup", self.onmouseup);
+              //self.bind(self.cursor, "mousemove", self.onmousemove);
+              self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
+                self.onmousedown(e, true);
+              });
+              //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
+              self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
+            } else {
+              self.bind(self.rail, "mousedown", function(e){e.preventDefault();});  // prevent text selection
+							self.railh&&self.bind(self.railh, "mousedown", function(e){e.preventDefault();});
+            }
+
+          }
+
+
+          if (self.opt.enablemousewheel) {
+            if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? document : self.win , self.onmousewheel);
+            self.mousewheel(self.rail, self.onmousewheel);
+            if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
+          }
+
+          if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
+            if (!self.win.attr("tabindex")) self.win.attr({
+              "tabindex": tabindexcounter++
+            });
+
+            self.jqbind(self.win, "focus", function(e) {
+              domfocus = (self.getTarget(e)).id || true;
+              self.hasfocus = true;
+              if (self.canshowonmouseevent) self.noticeCursor();
+            });
+            self.jqbind(self.win, "blur", function(e) {
+              domfocus = false;
+              self.hasfocus = false;
+            });
+
+            self.jqbind(self.win, "mouseenter", function(e) {
+              mousefocus = (self.getTarget(e)).id || true;
+              self.hasmousefocus = true;
+              if (self.canshowonmouseevent) self.noticeCursor();
+            });
+            self.jqbind(self.win, "mouseleave", function() {
+              mousefocus = false;
+              self.hasmousefocus = false;
+              if (!self.rail.drag) self.hideCursor();
+            });
+
+          }
+
+        } // !ie9mobile
+
+        //Thanks to http://www.quirksmode.org !!
+        self.onkeypress = function(e) {
+          if (self.railslocked && self.page.maxh == 0) return true;
+
+          e = (e) ? e : window.e;
+          var tg = self.getTarget(e);
+          if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
+            var tp = tg.getAttribute('type') || tg.type || false;
+            if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
+          }
+
+          if ($(tg).attr('contenteditable')) return true;
+
+          if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
+            var key = e.keyCode;
+
+            if (self.railslocked && key != 27) return self.cancelEvent(e);
+
+            var ctrl = e.ctrlKey || false;
+            var shift = e.shiftKey || false;
+
+            var ret = false;
+            switch (key) {
+              case 38:
+              case 63233: //safari
+                self.doScrollBy(24 * 3);
+                ret = true;
+                break;
+              case 40:
+              case 63235: //safari
+                self.doScrollBy(-24 * 3);
+                ret = true;
+                break;
+              case 37:
+              case 63232: //safari
+                if (self.railh) {
+                  (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
+                  ret = true;
+                }
+                break;
+              case 39:
+              case 63234: //safari
+                if (self.railh) {
+                  (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
+                  ret = true;
+                }
+                break;
+              case 33:
+              case 63276: // safari
+                self.doScrollBy(self.view.h);
+                ret = true;
+                break;
+              case 34:
+              case 63277: // safari
+                self.doScrollBy(-self.view.h);
+                ret = true;
+                break;
+              case 36:
+              case 63273: // safari
+                (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
+                ret = true;
+                break;
+              case 35:
+              case 63275: // safari
+                (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
+                ret = true;
+                break;
+              case 32:
+                if (self.opt.spacebarenabled) {
+                  (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
+                  ret = true;
+                }
+                break;
+              case 27: // ESC
+                if (self.zoomactive) {
+                  self.doZoom();
+                  ret = true;
+                }
+                break;
+            }
+            if (ret) return self.cancelEvent(e);
+          }
+        };
+
+        if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
+
+        self.bind(document, "keydown", function(e) {
+          var ctrl = e.ctrlKey || false;
+          if (ctrl) self.wheelprevented = true;
+        });
+        self.bind(document, "keyup", function(e) {
+          var ctrl = e.ctrlKey || false;
+          if (!ctrl) self.wheelprevented = false;
+        });
+        self.bind(window,"blur",function(e){
+          self.wheelprevented = false;
+        });
+
+        self.bind(window, 'resize', self.lazyResize);
+        self.bind(window, 'orientationchange', self.lazyResize);
+
+        self.bind(window, "load", self.lazyResize);
+
+        if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
+          var tmp = self.win.attr("style");
+          var ww = parseFloat(self.win.css("width")) + 1;
+          self.win.css('width', ww);
+          self.synched("chromefix", function() {
+            self.win.attr("style", tmp);
+          });
+        }
+
+
+        // Trying a cross-browser implementation - good luck!
+
+        self.onAttributeChange = function(e) {
+          self.lazyResize(self.isieold ? 250 : 30);
+        };
+
+        if ((!self.isie11) && (ClsMutationObserver !== false)) {  // IE11 crashes  #568
+          self.observerbody = new ClsMutationObserver(function(mutations) {
+            mutations.forEach(function(mut){
+              if (mut.type=="attributes") {
+                return ($("body").hasClass("modal-open") && $("body").hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0],self.doc[0])) ? self.hide() : self.show();  // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
+              }
+            });
+            if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
+          });
+          self.observerbody.observe(document.body, {
+            childList: true,
+            subtree: true,
+            characterData: false,
+            attributes: true,
+            attributeFilter: ['class']
+          });
+        }
+
+        if (!self.ispage && !self.haswrapper) {
+          // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
+          if (ClsMutationObserver !== false) {
+            self.observer = new ClsMutationObserver(function(mutations) {
+              mutations.forEach(self.onAttributeChange);
+            });
+            self.observer.observe(self.win[0], {
+              childList: true,
+              characterData: false,
+              attributes: true,
+              subtree: false
+            });
+            self.observerremover = new ClsMutationObserver(function(mutations) {
+              mutations.forEach(function(mo) {
+                if (mo.removedNodes.length > 0) {
+                  for (var dd in mo.removedNodes) {
+                    if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
+                  }
+                }
+              });
+            });
+            self.observerremover.observe(self.win[0].parentNode, {
+              childList: true,
+              characterData: false,
+              attributes: false,
+              subtree: false
+            });
+          } else {
+            self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
+            if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+            self.bind(self.win, "DOMNodeRemoved", function(e) {
+              if (e.target == self.win[0]) self.remove();
+            });
+          }
+        }
+
+        //
+
+        if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
+				if (self.istextarea) {
+					self.bind(self.win, "keydown", self.lazyResize);
+					self.bind(self.win, "mouseup", self.lazyResize);
+				}
+
+        //        self.checkrtlmode = true;
+        self.lazyResize(30);
+
+      }
+
+      if (this.doc[0].nodeName == 'IFRAME') {
+        var oniframeload = function() {
+          self.iframexd = false;
+          var doc;
+          try {
+            doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
+            var a = doc.domain;
+          } catch (e) {
+            self.iframexd = true;
+            doc = false;
+          }
+
+          if (self.iframexd) {
+            if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
+            return true; //cross-domain - I can't manage this
+          }
+
+          self.forcescreen = true;
+
+          if (self.isiframe) {
+            self.iframe = {
+              "doc": $(doc),
+              "html": self.doc.contents().find('html')[0],
+              "body": self.doc.contents().find('body')[0]
+            };
+            self.getContentSize = function() {
+              return {
+                w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
+                h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
+              };
+            };
+            self.docscroll = $(self.iframe.body); //$(this.contentWindow);
+          }
+
+          if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
+            self.win.scrollTop(0); // reset position
+            self.doc.height(""); //reset height to fix browser bug
+            var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
+            self.doc.height(hh);
+          }
+          self.lazyResize(30);
+
+          if (cap.isie7) self.css($(self.iframe.html), _scrollyhidden);
+          self.css($(self.iframe.body), _scrollyhidden);
+
+          if (cap.isios && self.haswrapper) {
+            self.css($(doc.body), {
+              '-webkit-transform': 'translate3d(0,0,0)'
+            }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
+          }
+
+          if ('contentWindow' in this) {
+            self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
+          } else {
+            self.bind(doc, "scroll", self.onscroll);
+          }
+
+          if (self.opt.enablemousewheel) {
+            self.mousewheel(doc, self.onmousewheel);
+          }
+
+          if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
+
+          if (cap.cantouch || self.opt.touchbehavior) {
+            self.bind(doc, "mousedown", self.ontouchstart);
+            self.bind(doc, "mousemove", function(e) {
+              return self.ontouchmove(e, true);
+            });
+            if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
+              'cursor': cap.cursorgrabvalue
+            });
+          }
+
+          self.bind(doc, "mouseup", self.ontouchend);
+
+          if (self.zoom) {
+            if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
+            if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
+          }
+        };
+
+        if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
+          setTimeout(function() {
+            oniframeload.call(self.doc[0], false);
+          }, 500);
+        }
+        self.bind(this.doc, "load", oniframeload);
+
+      }
+
+    };
+
+    this.showCursor = function(py, px) {
+      if (self.cursortimeout) {
+        clearTimeout(self.cursortimeout);
+        self.cursortimeout = 0;
+      }
+      if (!self.rail) return;
+      if (self.autohidedom) {
+        self.autohidedom.stop().css({
+          opacity: self.opt.cursoropacitymax
+        });
+        self.cursoractive = true;
+      }
+
+      if (!self.rail.drag || self.rail.drag.pt != 1) {
+        if (py !== undefined && py !== false) {
+          self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
+        }
+        if (px !== undefined) {
+          self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
+        }
+      }
+
+      self.cursor.css({
+        height: self.cursorheight,
+        top: self.scroll.y
+      });
+      if (self.cursorh) {
+        var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
+        (!self.rail.align && self.rail.visibility) ? self.cursorh.css({
+          width: self.cursorwidth,
+          left: lx + self.rail.width
+        }): self.cursorh.css({
+          width: self.cursorwidth,
+          left: lx
+        });
+        self.cursoractive = true;
+      }
+
+      if (self.zoom) self.zoom.stop().css({
+        opacity: self.opt.cursoropacitymax
+      });
+    };
+
+    this.hideCursor = function(tm) {
+      if (self.cursortimeout) return;
+      if (!self.rail) return;
+      if (!self.autohidedom) return;
+      if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
+      self.cursortimeout = setTimeout(function() {
+        if (!self.rail.active || !self.showonmouseevent) {
+          self.autohidedom.stop().animate({
+            opacity: self.opt.cursoropacitymin
+          });
+          if (self.zoom) self.zoom.stop().animate({
+            opacity: self.opt.cursoropacitymin
+          });
+          self.cursoractive = false;
+        }
+        self.cursortimeout = 0;
+      }, tm || self.opt.hidecursordelay);
+    };
+
+    this.noticeCursor = function(tm, py, px) {
+      self.showCursor(py, px);
+      if (!self.rail.active) self.hideCursor(tm);
+    };
+
+    this.getContentSize =
+      (self.ispage) ?
+      function() {
+        return {
+          w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
+          h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
+        };
+      } : (self.haswrapper) ?
+      function() {
+        return {
+          w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
+          h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
+        };
+      } : function() {
+        return {
+          w: self.docscroll[0].scrollWidth,
+          h: self.docscroll[0].scrollHeight
+        };
+      };
+
+    this.onResize = function(e, page) {
+
+      if (!self || !self.win) return false;
+
+      if (!self.haswrapper && !self.ispage) {
+        if (self.win.css('display') == 'none') {
+          if (self.visibility) self.hideRail().hideRailHr();
+          return false;
+        } else {
+          if (!self.hidden && !self.visibility) self.showRail().showRailHr();
+        }
+      }
+
+      var premaxh = self.page.maxh;
+      var premaxw = self.page.maxw;
+
+      var preview = {
+        h: self.view.h,
+        w: self.view.w
+      };
+
+      self.view = {
+        w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
+        h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
+      };
+
+      self.page = (page) ? page : self.getContentSize();
+
+      self.page.maxh = Math.max(0, self.page.h - self.view.h);
+      self.page.maxw = Math.max(0, self.page.w - self.view.w);
+
+      if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
+        // test position
+        if (!self.ispage) {
+          var pos = self.win.offset();
+          if (self.lastposition) {
+            var lst = self.lastposition;
+            if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do
+          }
+          self.lastposition = pos;
+        } else {
+          return self; //nothing to do
+        }
+      }
+
+      if (self.page.maxh == 0) {
+        self.hideRail();
+        self.scrollvaluemax = 0;
+        self.scroll.y = 0;
+        self.scrollratio.y = 0;
+        self.cursorheight = 0;
+        self.setScrollTop(0);
+        if (self.rail) self.rail.scrollable = false;
+      } else {
+        self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**
+        self.rail.scrollable = true;
+      }
+
+      if (self.page.maxw == 0) {
+        self.hideRailHr();
+        self.scrollvaluemaxw = 0;
+        self.scroll.x = 0;
+        self.scrollratio.x = 0;
+        self.cursorwidth = 0;
+        self.setScrollLeft(0);
+        if (self.railh) {
+          self.railh.scrollable = false;
+        }
+      } else {
+          self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right);  //**
+          if (self.railh) self.railh.scrollable = (self.opt.horizrailenabled);
+      }
+
+      self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
+      if (self.railslocked) {
+        if (!self.ispage) self.updateScrollBar(self.view);
+        return false;
+      }
+
+      if (!self.hidden && !self.visibility) {
+        self.showRail().showRailHr();
+      }
+      else if (self.railh && (!self.hidden && !self.railh.visibility)) self.showRailHr();
+
+      if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
+
+      self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
+      self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
+
+      self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
+      self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
+
+      self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom);  //**
+
+      if (self.railh) {
+        self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
+        self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right);  //**
+      }
+
+      /*
+      if (self.checkrtlmode&&self.railh) {
+        self.checkrtlmode = false;
+        if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
+      }
+*/
+
+      if (!self.ispage) self.updateScrollBar(self.view);
+
+      self.scrollratio = {
+        x: (self.page.maxw / self.scrollvaluemaxw),
+        y: (self.page.maxh / self.scrollvaluemax)
+      };
+
+      var sy = self.getScrollTop();
+      if (sy > self.page.maxh) {
+        self.doScrollTop(self.page.maxh);
+      } else {
+        self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+        self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+        if (self.cursoractive) self.noticeCursor();
+      }
+
+      if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
+
+      return self;
+    };
+
+    this.resize = self.onResize;
+
+		this.hlazyresize = 0;
+
+    this.lazyResize = function(tm) { // event debounce
+			if (self.hlazyresize) clearTimeout(self.hlazyresize);
+			self.hlazyresize = setTimeout(function(){
+				self && self.show().resize();
+			}, 1000);
+      return self;
+    };
+
+    // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
+    function _modernWheelEvent(dom, name, fn, bubble) {
+      self._bind(dom, name, function(e) {
+        var e = (e) ? e : window.event;
+        var event = {
+          original: e,
+          target: e.target || e.srcElement,
+          type: "wheel",
+          deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
+          deltaX: 0,
+          deltaZ: 0,
+          preventDefault: function() {
+            e.preventDefault ? e.preventDefault() : e.returnValue = false;
+            return false;
+          },
+          stopImmediatePropagation: function() {
+            (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
+          }
+        };
+
+        if (name == "mousewheel") {
+          e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
+					e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
+					!event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
+        } else {
+          event.deltaY = e.detail;
+        }
+
+        return fn.call(dom, event);
+      }, bubble);
+    }
+
+
+
+    this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
+      self.events.push({
+        e: dom,
+        n: name,
+        f: fn,
+        q: true
+      });
+      $(dom).bind(name, fn);
+    };
+
+    this.mousewheel = function(dom, fn, bubble) { // bind mousewheel
+      var el = ("jquery" in dom) ? dom[0] : dom;
+      if ("onwheel" in document.createElement("div")) { // Modern browsers support "wheel"
+        self._bind(el, "wheel", fn, bubble || false);
+      } else {
+        var wname = (document.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox
+        _modernWheelEvent(el, wname, fn, bubble || false);
+        if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
+      }
+    };
+
+    if (cap.haseventlistener) {  // W3C standard event model
+
+      this.bind = function(dom, name, fn, bubble) {  // W3C
+        var el = ("jquery" in dom) ? dom[0] : dom;
+        self._bind(el, name, fn, bubble || false);
+      };
+
+      this._bind = function(el, name, fn, bubble) { // primitive bind
+        self.events.push({
+          e: el,
+          n: name,
+          f: fn,
+          b: bubble,
+          q: false
+        });
+        el.addEventListener(name, fn, bubble || false);
+      };
+      this.cancelEvent = function(e) {
+        if (!e) return false;
+        var e = (e.original) ? e.original : e;
+        if (e.cancelable) e.preventDefault();
+        e.stopPropagation();
+        if (e.preventManipulation) e.preventManipulation(); //IE10
+        return false;
+      };
+      this.stopPropagation = function(e) {
+        if (!e) return false;
+        var e = (e.original) ? e.original : e;
+        e.stopPropagation();
+        return false;
+      };
+      this._unbind = function(el, name, fn, bub) { // primitive unbind
+        el.removeEventListener(name, fn, bub);
+      };
+    } else {  // old IE model
+
+      this.bind = function(dom, name, fn, bubble) {  // legacy IE
+        var el = ("jquery" in dom) ? dom[0] : dom;
+        self._bind(el, name, function(e) {
+          e = e || window.event || false;
+          if (e && e.srcElement) {
+            e.target = e.srcElement;
+          }
+          if (!("pageY" in e)) {
+            e.pageX = e.clientX + document.documentElement.scrollLeft;
+            e.pageY = e.clientY + document.documentElement.scrollTop;
+          }
+          return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
+        });
+      };
+
+      this._bind = function(el, name, fn, bubble) { // primitive bind
+        self.events.push({
+          e: el,
+          n: name,
+          f: fn,
+          b: bubble,
+          q: false
+        });
+        if (el.attachEvent) {
+          el.attachEvent("on" + name, fn);
+        } else {
+          el["on" + name] = fn;
+        }
+      };
+      // Thanks to http://www.switchonthecode.com !!
+      this.cancelEvent = function(e) {
+        var e = window.event || false;
+        if (!e) return false;
+        e.cancelBubble = true;
+        e.cancel = true;
+        e.returnValue = false;
+        return false;
+      };
+      this.stopPropagation = function(e) {
+        var e = window.event || false;
+        if (!e) return false;
+        e.cancelBubble = true;
+        return false;
+      };
+      this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
+        if (el.detachEvent) {
+          el.detachEvent('on' + name, fn);
+        } else {
+          el['on' + name] = false;
+        }
+      };
+    }
+
+    this.unbindAll = function() {
+      for (var a = 0; a < self.events.length; a++) {
+        var r = self.events[a];
+        (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
+      }
+    };
+
+    this.showRail = function() {
+      if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
+        self.visibility = true;
+        self.rail.visibility = true;
+        self.rail.css('display', 'block');
+      }
+      return self;
+    };
+
+    this.showRailHr = function() {
+      if (!self.railh) return self;
+      if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
+        self.railh.visibility = true;
+        self.railh.css('display', 'block');
+      }
+      return self;
+    };
+
+    this.hideRail = function() {
+      self.visibility = false;
+      self.rail.visibility = false;
+      self.rail.css('display', 'none');
+      return self;
+    };
+
+    this.hideRailHr = function() {
+      if (!self.railh) return self;
+      self.railh.visibility = false;
+      self.railh.css('display', 'none');
+      return self;
+    };
+
+    this.show = function() {
+      self.hidden = false;
+      self.railslocked = false;
+      return self.showRail().showRailHr();
+    };
+
+    this.hide = function() {
+      self.hidden = true;
+      self.railslocked = true;
+      return self.hideRail().hideRailHr();
+    };
+
+    this.toggle = function() {
+      return (self.hidden) ? self.show() : self.hide();
+    };
+
+    this.remove = function() {
+      self.stop();
+      if (self.cursortimeout) clearTimeout(self.cursortimeout);
+//      if (self.debouncedelayed) clearTimeout(self.debouncedelayed);
+			for(var n in self.delaylist) if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
+      self.doZoomOut();
+      self.unbindAll();
+
+      if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
+
+      if (self.observer !== false) self.observer.disconnect();
+      if (self.observerremover !== false) self.observerremover.disconnect();
+      if (self.observerbody !== false) self.observerbody.disconnect();
+
+      self.events = null;
+
+      if (self.cursor) {
+        self.cursor.remove();
+      }
+      if (self.cursorh) {
+        self.cursorh.remove();
+      }
+      if (self.rail) {
+        self.rail.remove();
+      }
+      if (self.railh) {
+        self.railh.remove();
+      }
+      if (self.zoom) {
+        self.zoom.remove();
+      }
+      for (var a = 0; a < self.saved.css.length; a++) {
+        var d = self.saved.css[a];
+        d[0].css(d[1], (d[2] === undefined) ? '' : d[2]);
+      }
+      self.saved = false;
+      self.me.data('__nicescroll', ''); //erase all traces
+
+      // memory leak fixed by GianlucaGuarini - thanks a lot!
+      // remove the current nicescroll from the $.nicescroll array & normalize array
+      var lst = $.nicescroll;
+      lst.each(function(i) {
+        if (!this) return;
+        if (this.id === self.id) {
+          delete lst[i];
+          for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
+          lst.length--;
+          if (lst.length) delete lst[lst.length];
+        }
+      });
+
+      for (var i in self) {
+        self[i] = null;
+        delete self[i];
+      }
+
+      self = null;
+
+    };
+
+    this.scrollstart = function(fn) {
+      this.onscrollstart = fn;
+      return self;
+    };
+    this.scrollend = function(fn) {
+      this.onscrollend = fn;
+      return self;
+    };
+    this.scrollcancel = function(fn) {
+      this.onscrollcancel = fn;
+      return self;
+    };
+
+    this.zoomin = function(fn) {
+      this.onzoomin = fn;
+      return self;
+    };
+    this.zoomout = function(fn) {
+      this.onzoomout = fn;
+      return self;
+    };
+
+    this.isScrollable = function(e) {
+      var dom = (e.target) ? e.target : e;
+      if (dom.nodeName == 'OPTION') return true;
+      while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
+        var dd = $(dom);
+        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
+        if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
+        dom = (dom.parentNode) ? dom.parentNode : false;
+      }
+      return false;
+    };
+
+    this.getViewport = function(me) {
+      var dom = (me && me.parentNode) ? me.parentNode : false;
+      while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
+        var dd = $(dom);
+        if (/fixed|absolute/.test(dd.css("position"))) return dd;
+        var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
+        if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
+        if (dd.getNiceScroll().length > 0) return dd;
+        dom = (dom.parentNode) ? dom.parentNode : false;
+      }
+      return false; //(dom) ? $(dom) : false;
+    };
+
+    this.triggerScrollEnd = function() {
+      if (!self.onscrollend) return;
+
+      var px = self.getScrollLeft();
+      var py = self.getScrollTop();
+
+      var info = {
+        type: "scrollend",
+        current: {
+          x: px,
+          y: py
+        },
+        end: {
+          x: px,
+          y: py
+        }
+      };
+      self.onscrollend.call(self, info);
+    };
+
+    function execScrollWheel(e, hr, chkscroll) {
+      var px, py;
+
+      if (e.deltaMode == 0) { // PIXEL
+        px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
+        py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
+      } else if (e.deltaMode == 1) { // LINE
+        px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
+        py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
+      }
+
+      if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support
+        px = py;
+        py = 0;
+
+        if (chkscroll) {
+          var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
+          if (hrend) {  // preserve vertical scrolling
+            py = px;
+            px = 0;
+          }
+        }
+
+      }
+
+      // invert horizontal direction for rtl mode
+      if (self.isrtlmode) px = -px;
+
+      if (px) {
+        if (self.scrollmom) {
+          self.scrollmom.stop();
+        }
+        self.lastdeltax += px;
+        self.debounced("mousewheelx", function() {
+          var dt = self.lastdeltax;
+          self.lastdeltax = 0;
+          if (!self.rail.drag) {
+            self.doScrollLeftBy(dt);
+          }
+        }, 15);
+      }
+      if (py) {
+        if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
+          if (py < 0) {
+            if (self.getScrollTop() >= self.page.maxh) return true;
+          } else {
+            if (self.getScrollTop() <= 0) return true;
+          }
+        }
+        if (self.scrollmom) {
+          self.scrollmom.stop();
+        }
+        self.lastdeltay += py;
+//        self.debounced("mousewheely", function() {
+	      self.synched("mousewheely", function() {
+          var dt = self.lastdeltay;
+          self.lastdeltay = 0;
+          if (!self.rail.drag) {
+            self.doScrollBy(dt);
+          }
+        }, 15);
+      }
+
+      e.stopImmediatePropagation();
+      return e.preventDefault();
+    }
+
+    this.onmousewheel = function(e) {
+      if (self.wheelprevented) return;
+      if (self.railslocked) {
+        self.debounced("checkunlock", self.resize, 250);
+        return true;
+      }
+      if (self.rail.drag) return self.cancelEvent(e);
+
+      if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
+
+      if (self.opt.oneaxismousemode && e.deltaX == 0) {
+        if (!self.rail.scrollable) {
+          if (self.railh && self.railh.scrollable) {
+            return self.onmousewheelhr(e);
+          } else {
+            return true;
+          }
+        }
+      }
+
+      var nw = +(new Date());
+      var chk = false;
+      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+        self.nativescrollingarea = self.isScrollable(e);
+        chk = true;
+      }
+      self.checkarea = nw;
+      if (self.nativescrollingarea) return true; // this isn't my business
+      var ret = execScrollWheel(e, false, chk);
+      if (ret) self.checkarea = 0;
+      return ret;
+    };
+
+    this.onmousewheelhr = function(e) {
+      if (self.wheelprevented) return;
+      if (self.railslocked || !self.railh.scrollable) return true;
+      if (self.rail.drag) return self.cancelEvent(e);
+
+      var nw = +(new Date());
+      var chk = false;
+      if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
+        self.nativescrollingarea = self.isScrollable(e);
+        chk = true;
+      }
+      self.checkarea = nw;
+      if (self.nativescrollingarea) return true; // this isn't my business
+      if (self.railslocked) return self.cancelEvent(e);
+
+      return execScrollWheel(e, true, chk);
+    };
+
+    this.stop = function() {
+      self.cancelScroll();
+      if (self.scrollmon) self.scrollmon.stop();
+      self.cursorfreezed = false;
+      self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+      self.noticeCursor();
+      return self;
+    };
+
+    this.getTransitionSpeed = function(dif) {
+      var sp = Math.round(self.opt.scrollspeed * 10);
+      var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
+      return (ex > 20) ? ex : 0;
+    };
+
+    if (!self.opt.smoothscroll) {
+      this.doScrollLeft = function(x, spd) { //direct
+        var y = self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+      this.doScrollTop = function(y, spd) { //direct
+        var x = self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+      this.doScrollPos = function(x, y, spd) { //direct
+        var nx = (x > self.page.maxw) ? self.page.maxw : x;
+        if (nx < 0) nx = 0;
+        var ny = (y > self.page.maxh) ? self.page.maxh : y;
+        if (ny < 0) ny = 0;
+        self.synched('scroll', function() {
+          self.setScrollTop(ny);
+          self.setScrollLeft(nx);
+        });
+      };
+      this.cancelScroll = function() {}; // direct
+    } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
+      this.prepareTransition = function(dif, istime) {
+        var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
+        var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
+        if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
+          self.lasttransitionstyle = trans;
+          self.doc.css(cap.transitionstyle, trans);
+        }
+        return ex;
+      };
+
+      this.doScrollLeft = function(x, spd) { //trans
+        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollTop = function(y, spd) { //trans
+        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollPos = function(x, y, spd) { //trans
+
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+
+        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
+
+        if (self.opt.bouncescroll == false) {
+          if (y < 0) y = 0;
+          else if (y > self.page.maxh) y = self.page.maxh;
+          if (x < 0) x = 0;
+          else if (x > self.page.maxw) x = self.page.maxw;
+        }
+
+        if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
+
+        self.newscrolly = y;
+        self.newscrollx = x;
+
+        self.newscrollspeed = spd || false;
+
+        if (self.timer) return false;
+
+        self.timer = setTimeout(function() {
+
+          var top = self.getScrollTop();
+          var lft = self.getScrollLeft();
+
+          var dst = {};
+          dst.x = x - lft;
+          dst.y = y - top;
+          dst.px = lft;
+          dst.py = top;
+
+          var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
+          var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
+          if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
+
+          self.prepareTransition(ms, true);
+
+          if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+
+          if (ms > 0) {
+
+            if (!self.scrollrunning && self.onscrollstart) {
+              var info = {
+                "type": "scrollstart",
+                "current": {
+                  "x": lft,
+                  "y": top
+                },
+                "request": {
+                  "x": x,
+                  "y": y
+                },
+                "end": {
+                  "x": self.newscrollx,
+                  "y": self.newscrolly
+                },
+                "speed": ms
+              };
+              self.onscrollstart.call(self, info);
+            }
+
+            if (cap.transitionend) {
+              if (!self.scrollendtrapped) {
+                self.scrollendtrapped = true;
+                self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
+              }
+            } else {
+              if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
+              self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
+            }
+
+            var py = top;
+            var px = lft;
+            self.timerscroll = {
+              bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
+              bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
+            };
+            if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
+              self.showCursor(self.getScrollTop(), self.getScrollLeft());
+            }, 60);
+
+          }
+
+          self.synched("doScroll-set", function() {
+            self.timer = 0;
+            if (self.scrollendtrapped) self.scrollrunning = true;
+            self.setScrollTop(self.newscrolly);
+            self.setScrollLeft(self.newscrollx);
+            if (!self.scrollendtrapped) self.onScrollTransitionEnd();
+          });
+
+
+        }, 50);
+
+      };
+
+      this.cancelScroll = function() {
+        if (!self.scrollendtrapped) return true;
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+        self.scrollrunning = false;
+        if (!cap.transitionend) clearTimeout(cap.transitionend);
+        self.scrollendtrapped = false;
+        self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
+        self.prepareTransition(0);
+        self.setScrollTop(py); // fire event onscroll
+        if (self.railh) self.setScrollLeft(px);
+        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+        self.timerscroll = false;
+
+        self.cursorfreezed = false;
+
+        self.showCursor(py, px);
+        return self;
+      };
+      this.onScrollTransitionEnd = function() {
+        if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
+        self.scrollendtrapped = false;
+        self.prepareTransition(0);
+        if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
+        self.timerscroll = false;
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+        self.setScrollTop(py); // fire event onscroll
+        if (self.railh) self.setScrollLeft(px); // fire event onscroll left
+
+        self.noticeCursor(false, py, px);
+
+        self.cursorfreezed = false;
+
+        if (py < 0) py = 0;
+        else if (py > self.page.maxh) py = self.page.maxh;
+        if (px < 0) px = 0;
+        else if (px > self.page.maxw) px = self.page.maxw;
+        if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
+
+        if (self.onscrollend && self.scrollrunning) {
+          self.triggerScrollEnd();
+        }
+        self.scrollrunning = false;
+
+      };
+
+    } else {
+
+      this.doScrollLeft = function(x, spd) { //no-trans
+        var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollTop = function(y, spd) { //no-trans
+        var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
+        self.doScrollPos(x, y, spd);
+      };
+
+      this.doScrollPos = function(x, y, spd) { //no-trans
+        var y = (y === undefined || y === false) ? self.getScrollTop(true) : y;
+
+        if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
+
+        if (self.timer) clearAnimationFrame(self.timer);
+        self.timer = 0;
+
+        var py = self.getScrollTop();
+        var px = self.getScrollLeft();
+
+        if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
+
+        self.newscrolly = y;
+        self.newscrollx = x;
+
+        if (!self.bouncescroll || !self.rail.visibility) {
+          if (self.newscrolly < 0) {
+            self.newscrolly = 0;
+          } else if (self.newscrolly > self.page.maxh) {
+            self.newscrolly = self.page.maxh;
+          }
+        }
+        if (!self.bouncescroll || !self.railh.visibility) {
+          if (self.newscrollx < 0) {
+            self.newscrollx = 0;
+          } else if (self.newscrollx > self.page.maxw) {
+            self.newscrollx = self.page.maxw;
+          }
+        }
+
+        self.dst = {};
+        self.dst.x = x - px;
+        self.dst.y = y - py;
+        self.dst.px = px;
+        self.dst.py = py;
+
+        var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
+
+        self.dst.ax = self.dst.x / dst;
+        self.dst.ay = self.dst.y / dst;
+
+        var pa = 0;
+        var pe = dst;
+
+        if (self.dst.x == 0) {
+          pa = py;
+          pe = y;
+          self.dst.ay = 1;
+          self.dst.py = 0;
+        } else if (self.dst.y == 0) {
+          pa = px;
+          pe = x;
+          self.dst.ax = 1;
+          self.dst.px = 0;
+        }
+
+        var ms = self.getTransitionSpeed(dst);
+        if (spd && spd <= 1) ms *= spd;
+        if (ms > 0) {
+          self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
+        } else {
+          self.bzscroll = false;
+        }
+
+        if (self.timer) return;
+
+        if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
+
+        var sync = 1;
+
+        function scrolling() {
+          if (self.cancelAnimationFrame) return true;
+
+          self.scrollrunning = true;
+
+          sync = 1 - sync;
+          if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
+
+          var done = 0;
+          var sx, sy;
+
+          var sc = sy = self.getScrollTop();
+          if (self.dst.ay) {
+            sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
+            var dr = sc - sy;
+            if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
+            self.setScrollTop(sc);
+            if (sc == self.newscrolly) done = 1;
+          } else {
+            done = 1;
+          }
+
+          var scx = sx = self.getScrollLeft();
+          if (self.dst.ax) {
+            scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
+            var dr = scx - sx;
+            if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
+            self.setScrollLeft(scx);
+            if (scx == self.newscrollx) done += 1;
+          } else {
+            done += 1;
+          }
+
+          if (done == 2) {
+            self.timer = 0;
+            self.cursorfreezed = false;
+            self.bzscroll = false;
+            self.scrollrunning = false;
+            if (sc < 0) sc = 0;
+            else if (sc > self.page.maxh) sc = Math.max(0,self.page.maxh);
+            if (scx < 0) scx = 0;
+            else if (scx > self.page.maxw) scx = self.page.maxw;
+            if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
+            else {
+              if (self.onscrollend) {
+                self.triggerScrollEnd();
+              }
+            }
+          } else {
+            self.timer = setAnimationFrame(scrolling) || 1;
+          }
+        }
+        self.cancelAnimationFrame = false;
+        self.timer = 1;
+
+        if (self.onscrollstart && !self.scrollrunning) {
+          var info = {
+            "type": "scrollstart",
+            "current": {
+              "x": px,
+              "y": py
+            },
+            "request": {
+              "x": x,
+              "y": y
+            },
+            "end": {
+              "x": self.newscrollx,
+              "y": self.newscrolly
+            },
+            "speed": ms
+          };
+          self.onscrollstart.call(self, info);
+        }
+
+        scrolling();
+
+        if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
+
+        self.noticeCursor();
+      };
+
+      this.cancelScroll = function() {
+        if (self.timer) clearAnimationFrame(self.timer);
+        self.timer = 0;
+        self.bzscroll = false;
+        self.scrollrunning = false;
+        return self;
+      };
+
+    }
+
+    this.doScrollBy = function(stp, relative) {
+      var ny = 0;
+      if (relative) {
+        ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y);
+      } else {
+        var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
+        ny = sy - stp;
+      }
+      if (self.bouncescroll) {
+        var haf = Math.round(self.view.h / 2);
+        if (ny < -haf) ny = -haf;
+        else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
+      }
+      self.cursorfreezed = false;
+
+      var py = self.getScrollTop(true);
+      if (ny < 0 && py <= 0) return self.noticeCursor();
+      else if (ny > self.page.maxh && py >= self.page.maxh) {
+        self.checkContentSize();
+        return self.noticeCursor();
+      }
+
+      self.doScrollTop(ny);
+    };
+
+    this.doScrollLeftBy = function(stp, relative) {
+      var nx = 0;
+      if (relative) {
+        nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x);
+      } else {
+        var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
+        nx = sx - stp;
+      }
+      if (self.bouncescroll) {
+        var haf = Math.round(self.view.w / 2);
+        if (nx < -haf) nx = -haf;
+        else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
+      }
+      self.cursorfreezed = false;
+
+      var px = self.getScrollLeft(true);
+      if (nx < 0 && px <= 0) return self.noticeCursor();
+      else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
+
+      self.doScrollLeft(nx);
+    };
+
+    this.doScrollTo = function(pos, relative) {
+      var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
+      if (ny < 0) ny = 0;
+      else if (ny > self.page.maxh) ny = self.page.maxh;
+      self.cursorfreezed = false;
+      self.doScrollTop(pos);
+    };
+
+    this.checkContentSize = function() {
+      var pg = self.getContentSize();
+      if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
+    };
+
+    self.onscroll = function(e) {
+      if (self.rail.drag) return;
+      if (!self.cursorfreezed) {
+        self.synched('scroll', function() {
+          self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
+          if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
+          self.noticeCursor();
+        });
+      }
+    };
+    self.bind(self.docscroll, "scroll", self.onscroll);
+
+    this.doZoomIn = function(e) {
+      if (self.zoomactive) return;
+      self.zoomactive = true;
+
+      self.zoomrestore = {
+        style: {}
+      };
+      var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
+      var win = self.win[0].style;
+      for (var a in lst) {
+        var pp = lst[a];
+        self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
+      }
+
+      self.zoomrestore.style.width = self.win.css('width');
+      self.zoomrestore.style.height = self.win.css('height');
+
+      self.zoomrestore.padding = {
+        w: self.win.outerWidth() - self.win.width(),
+        h: self.win.outerHeight() - self.win.height()
+      };
+
+      if (cap.isios4) {
+        self.zoomrestore.scrollTop = $(window).scrollTop();
+        $(window).scrollTop(0);
+      }
+
+      self.win.css({
+        position: (cap.isios4) ? "absolute" : "fixed",
+        top: 0,
+        left: 0,
+        zIndex: globalmaxzindex + 100,
+        margin: 0
+      });
+      var bkg = self.win.css("backgroundColor");
+      if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
+      self.rail.css({
+        zIndex: globalmaxzindex + 101
+      });
+      self.zoom.css({
+        zIndex: globalmaxzindex + 102
+      });
+      self.zoom.css('backgroundPosition', '0px -18px');
+      self.resizeZoom();
+
+      if (self.onzoomin) self.onzoomin.call(self);
+
+      return self.cancelEvent(e);
+    };
+
+    this.doZoomOut = function(e) {
+      if (!self.zoomactive) return;
+      self.zoomactive = false;
+
+      self.win.css("margin", "");
+      self.win.css(self.zoomrestore.style);
+
+      if (cap.isios4) {
+        $(window).scrollTop(self.zoomrestore.scrollTop);
+      }
+
+      self.rail.css({
+        "z-index": self.zindex
+      });
+      self.zoom.css({
+        "z-index": self.zindex
+      });
+      self.zoomrestore = false;
+      self.zoom.css('backgroundPosition', '0px 0px');
+      self.onResize();
+
+      if (self.onzoomout) self.onzoomout.call(self);
+
+      return self.cancelEvent(e);
+    };
+
+    this.doZoom = function(e) {
+      return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
+    };
+
+    this.resizeZoom = function() {
+      if (!self.zoomactive) return;
+
+      var py = self.getScrollTop(); //preserve scrolling position
+      self.win.css({
+        width: $(window).width() - self.zoomrestore.padding.w + "px",
+        height: $(window).height() - self.zoomrestore.padding.h + "px"
+      });
+      self.onResize();
+
+      self.setScrollTop(Math.min(self.page.maxh, py));
+    };
+
+    this.init();
+
+    $.nicescroll.push(this);
+
+  };
+
+  // Inspired by the work of Kin Blas
+  // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
+
+
+  var ScrollMomentumClass2D = function(nc) {
+    var self = this;
+    this.nc = nc;
+
+    this.lastx = 0;
+    this.lasty = 0;
+    this.speedx = 0;
+    this.speedy = 0;
+    this.lasttime = 0;
+    this.steptime = 0;
+    this.snapx = false;
+    this.snapy = false;
+    this.demulx = 0;
+    this.demuly = 0;
+
+    this.lastscrollx = -1;
+    this.lastscrolly = -1;
+
+    this.chkx = 0;
+    this.chky = 0;
+
+    this.timer = 0;
+
+    this.time = function() {
+      return +new Date(); //beautifull hack
+    };
+
+    this.reset = function(px, py) {
+      self.stop();
+      var now = self.time();
+      self.steptime = 0;
+      self.lasttime = now;
+      self.speedx = 0;
+      self.speedy = 0;
+      self.lastx = px;
+      self.lasty = py;
+      self.lastscrollx = -1;
+      self.lastscrolly = -1;
+    };
+
+    this.update = function(px, py) {
+      var now = self.time();
+      self.steptime = now - self.lasttime;
+      self.lasttime = now;
+      var dy = py - self.lasty;
+      var dx = px - self.lastx;
+      var sy = self.nc.getScrollTop();
+      var sx = self.nc.getScrollLeft();
+      var newy = sy + dy;
+      var newx = sx + dx;
+      self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
+      self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
+      self.speedx = dx;
+      self.speedy = dy;
+      self.lastx = px;
+      self.lasty = py;
+    };
+
+    this.stop = function() {
+      self.nc.unsynched("domomentum2d");
+      if (self.timer) clearTimeout(self.timer);
+      self.timer = 0;
+      self.lastscrollx = -1;
+      self.lastscrolly = -1;
+    };
+
+    this.doSnapy = function(nx, ny) {
+      var snap = false;
+
+      if (ny < 0) {
+        ny = 0;
+        snap = true;
+      } else if (ny > self.nc.page.maxh) {
+        ny = self.nc.page.maxh;
+        snap = true;
+      }
+
+      if (nx < 0) {
+        nx = 0;
+        snap = true;
+      } else if (nx > self.nc.page.maxw) {
+        nx = self.nc.page.maxw;
+        snap = true;
+      }
+
+      (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
+    };
+
+    this.doMomentum = function(gp) {
+      var t = self.time();
+      var l = (gp) ? t + gp : self.lasttime;
+
+      var sl = self.nc.getScrollLeft();
+      var st = self.nc.getScrollTop();
+
+      var pageh = self.nc.page.maxh;
+      var pagew = self.nc.page.maxw;
+
+      self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
+      self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
+
+      var chk = l && (t - l) <= 60;
+
+      if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
+
+      var sy = (self.speedy && chk) ? self.speedy : false;
+      var sx = (self.speedx && chk) ? self.speedx : false;
+
+      if (sy || sx) {
+        var tm = Math.max(16, self.steptime); //timeout granularity
+
+        if (tm > 50) { // do smooth
+          var xm = tm / 50;
+          self.speedx *= xm;
+          self.speedy *= xm;
+          tm = 50;
+        }
+
+        self.demulxy = 0;
+
+        self.lastscrollx = self.nc.getScrollLeft();
+        self.chkx = self.lastscrollx;
+        self.lastscrolly = self.nc.getScrollTop();
+        self.chky = self.lastscrolly;
+
+        var nx = self.lastscrollx;
+        var ny = self.lastscrolly;
+
+        var onscroll = function() {
+          var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
+
+          if (self.speedx) {
+            nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
+            self.lastscrollx = nx;
+            if ((nx < 0) || (nx > pagew)) df = 0.10;
+          }
+
+          if (self.speedy) {
+            ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
+            self.lastscrolly = ny;
+            if ((ny < 0) || (ny > pageh)) df = 0.10;
+          }
+
+          self.demulxy = Math.min(1, self.demulxy + df);
+
+          self.nc.synched("domomentum2d", function() {
+
+            if (self.speedx) {
+              var scx = self.nc.getScrollLeft();
+//              if (scx != self.chkx) self.stop();
+              self.chkx = nx;
+              self.nc.setScrollLeft(nx);
+            }
+
+            if (self.speedy) {
+              var scy = self.nc.getScrollTop();
+//              if (scy != self.chky) self.stop();
+              self.chky = ny;
+              self.nc.setScrollTop(ny);
+            }
+
+            if (!self.timer) {
+              self.nc.hideCursor();
+              self.doSnapy(nx, ny);
+            }
+
+          });
+
+          if (self.demulxy < 1) {
+            self.timer = setTimeout(onscroll, tm);
+          } else {
+            self.stop();
+            self.nc.hideCursor();
+            self.doSnapy(nx, ny);
+          }
+        };
+
+        onscroll();
+
+      } else {
+        self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
+      }
+
+    };
+
+  };
+
+
+  // override jQuery scrollTop
+
+  var _scrollTop = jQuery.fn.scrollTop; // preserve original function
+
+  jQuery.cssHooks.pageYOffset = {
+    get: function(elem, computed, extra) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
+    },
+    set: function(elem, value) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
+      return this;
+    }
+  };
+
+  /*
+  $.fx.step["scrollTop"] = function(fx){
+    $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
+  };
+*/
+
+  jQuery.fn.scrollTop = function(value) {
+    if (value === undefined) {
+      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
+      return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
+    } else {
+      return this.each(function() {
+        var nice = $.data(this, '__nicescroll') || false;
+        (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
+      });
+    }
+  };
+
+  // override jQuery scrollLeft
+
+  var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
+
+  $.cssHooks.pageXOffset = {
+    get: function(elem, computed, extra) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
+    },
+    set: function(elem, value) {
+      var nice = $.data(elem, '__nicescroll') || false;
+      (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
+      return this;
+    }
+  };
+
+  /*
+  $.fx.step["scrollLeft"] = function(fx){
+    $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
+  };
+*/
+
+  jQuery.fn.scrollLeft = function(value) {
+    if (value === undefined) {
+      var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
+      return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
+    } else {
+      return this.each(function() {
+        var nice = $.data(this, '__nicescroll') || false;
+        (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
+      });
+    }
+  };
+
+  var NiceScrollArray = function(doms) {
+    var self = this;
+    this.length = 0;
+    this.name = "nicescrollarray";
+
+    this.each = function(fn) {
+      $.each(self, fn);
+      return self;
+    };
+
+    this.push = function(nice) {
+      self[self.length] = nice;
+      self.length++;
+    };
+
+    this.eq = function(idx) {
+      return self[idx];
+    };
+
+    if (doms) {
+      for (var a = 0; a < doms.length; a++) {
+        var nice = $.data(doms[a], '__nicescroll') || false;
+        if (nice) {
+          this[this.length] = nice;
+          this.length++;
+        }
+      }
+    }
+
+    return this;
+  };
+
+  function mplex(el, lst, fn) {
+    for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
+  }
+  mplex(
+    NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
+    function(e, n) {
+      e[n] = function() {
+        var args = arguments;
+        return this.each(function() {
+          this[n].apply(this, args);
+        });
+      };
+    }
+  );
+
+  jQuery.fn.getNiceScroll = function(index) {
+    if (index === undefined) {
+      return new NiceScrollArray(this);
+    } else {
+      return this[index] && $.data(this[index], '__nicescroll') || false;
+    }
+  };
+
+  jQuery.expr[':'].nicescroll = function(a) {
+    return $.data(a, '__nicescroll') !== undefined;
+  };
+
+  $.fn.niceScroll = function(wrapper, opt) {
+    if (opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
+      opt = wrapper;
+      wrapper = false;
+    }
+    opt = $.extend({},opt); // cloning
+    var ret = new NiceScrollArray();
+    if (opt === undefined) opt = {};
+
+    if (wrapper || false) {
+      opt.doc = $(wrapper);
+      opt.win = $(this);
+    }
+    var docundef = !("doc" in opt);
+    if (!docundef && !("win" in opt)) opt.win = $(this);
+
+    this.each(function() {
+      var nice = $(this).data('__nicescroll') || false;
+      if (!nice) {
+        opt.doc = (docundef) ? $(this) : opt.doc;
+        nice = new NiceScrollClass(opt, $(this));
+        $(this).data('__nicescroll', nice);
+      }
+      ret.push(nice);
+    });
+    return (ret.length == 1) ? ret[0] : ret;
+  };
+
+  window.NiceScroll = {
+    getjQuery: function() {
+      return jQuery;
+    }
+  };
+
+  if (!$.nicescroll) {
+    $.nicescroll = new NiceScrollArray();
+    $.nicescroll.options = _globaloptions;
+  }
+
+}));
+

+ 1 - 1
desktop/core/src/desktop/templates/common_header.mako

@@ -194,7 +194,7 @@ if USE_NEW_EDITOR.get():
   <script src="${ static('desktop/ext/js/jquery/plugins/jquery.total-storage.min.js') }"></script>
   <script src="${ static('desktop/ext/js/jquery/plugins/jquery.total-storage.min.js') }"></script>
   <script src="${ static('desktop/ext/js/jquery/plugins/jquery.placeholder.min.js') }"></script>
   <script src="${ static('desktop/ext/js/jquery/plugins/jquery.placeholder.min.js') }"></script>
   <script src="${ static('desktop/ext/js/jquery/plugins/jquery.dataTables.1.8.2.min.js') }"></script>
   <script src="${ static('desktop/ext/js/jquery/plugins/jquery.dataTables.1.8.2.min.js') }"></script>
-  <script src="${ static('desktop/ext/js/jquery/plugins/jquery.nicescroll.min.js') }"></script>
+  <script src="${ static('desktop/js/jquery.nicescroll.js') }"></script>
   <script src="${ static('desktop/js/jquery.datatables.sorting.js') }"></script>
   <script src="${ static('desktop/js/jquery.datatables.sorting.js') }"></script>
   <script src="${ static('desktop/ext/js/bootstrap.min.js') }"></script>
   <script src="${ static('desktop/ext/js/bootstrap.min.js') }"></script>
   <script src="${ static('desktop/ext/js/bootstrap-better-typeahead.min.js') }"></script>
   <script src="${ static('desktop/ext/js/bootstrap-better-typeahead.min.js') }"></script>